![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
This content is being served through the AFS server rosebud.mit.edu in the sipb.mit.edu AFS cell. If you have any questions about this content, please contact the administrator of this directory, who made it publicly available. The administrators of the stuff.mit.edu AFS gateway are not responsible for this content and have no ability to remove it.
The administrator of this directory is eichin of sipb.mit.edu.
| Name | Last modified | Size |
|---|---|---|---|
| Parent Directory | - | |
| mosquito.math/ | 1992-09-20 22:43 | - |
| 6811 | 1993-06-19 23:32 | 1.3K |
| AIX3.1-sharedlibs.z | 1991-08-18 17:21 | 4.4K |
| AMIX-info.z | 1992-03-11 02:48 | 5.2K |
| ARCHIE.z | 1991-02-10 22:26 | 47 |
| CAFFEINE.z | 1991-08-05 03:35 | 10K |
| Chaosnet.dying.z | 1991-09-23 23:18 | 1.1K |
| FOIA.z | 1990-11-26 15:45 | 1.3K |
| GNURM.z | 1992-03-11 03:02 | 1.5K |
| HOTLINE.z | 1991-04-01 02:26 | 2.2K |
| IEFBR14.z | 1991-04-03 21:25 | 2.0K |
| InterViews.FAQ.z | 1991-06-18 22:52 | 3.8K |
| LICENSE.EXAMS.z | 1991-08-27 19:43 | 5.0K |
| LPF.papers.z | 1991-10-14 22:49 | 21K |
| LSD-humour.z | 1991-01-06 23:02 | 1.1K |
| Lotus-defnse.z | 1991-01-03 17:25 | 2.7K |
| MD4.paper.z | 1990-07-23 17:23 | 3.7K |
| NO-CODE-LICENSE.z | 1991-01-07 01:49 | 1.4K |
| PC-survival.z | 1992-01-23 15:22 | 4.1K |
| Rush.Bozo.z | 1991-08-28 00:39 | 9.9K |
| SMURPH.z | 1990-08-23 02:36 | 1.1K |
| SPT.z | 1992-06-29 17:29 | 4.0K |
| SSN-hiding.z | 1991-06-28 04:04 | 9.4K |
| SSN.structure.z | 1992-06-25 15:55 | 4.1K |
| Strings+Springs.z | 1991-09-04 12:48 | 701 |
| Uncomfortable.Truths.z | 1991-10-24 09:49 | 2.7K |
| VAXORCIST.z | 1991-08-09 05:23 | 7.5K |
| Xess.doc.z | 1990-09-19 07:24 | 8.5K |
| Y-compress.z | 1991-01-31 20:02 | 1.5K |
| YABBA.z | 1991-03-22 19:08 | 788 |
| Zephyr.Miss-manners.z | 1991-11-23 18:47 | 1.0K |
| abstract-lions.z | 1991-01-10 13:35 | 4.6K |
| acm-contest.z | 1991-07-04 17:13 | 1.1K |
| adobe-acrobat-pdf | 1993-06-17 13:15 | 797 |
| air-cylinder.boom | 1993-06-27 05:12 | 5.1K |
| alices-nntp | 1993-09-07 11:27 | 19K |
| ancient-phones.z | 1990-05-07 22:12 | 1.4K |
| andrew-demo.z | 1992-04-01 01:39 | 2.1K |
| applelink.in.space.z | 1991-08-13 01:17 | 1.5K |
| apples.z | 1990-10-15 13:37 | 1.8K |
| arpanet.rip.z | 1990-03-17 14:50 | 872 |
| athena.size.z | 1990-08-31 23:53 | 1.6K |
| bankcard.z | 1992-01-10 21:47 | 1.5K |
| barney-horror | 1993-09-17 18:33 | 191K |
| bates.z | 1991-09-04 12:56 | 2.2K |
| berkeley.beacon.z | 1991-10-14 19:36 | 5.9K |
| big-grplists.z | 1991-06-28 11:45 | 682 |
| black-zombie.recipe.z | 1991-12-17 17:47 | 1.1K |
| bunny-burgers.z | 1992-05-29 17:54 | 10K |
| buysun.z | 1990-07-23 20:30 | 1.3K |
| buzzword-oriented-programming.z | 1991-04-23 14:31 | 1.0K |
| byte.crypt.z | 1990-06-26 03:22 | 1.9K |
| c++GC.ref.z | 1990-07-17 20:58 | 1.0K |
| canticle.z | 1990-09-19 07:07 | 562 |
| car.proms.z | 1991-11-09 13:40 | 8.4K |
| carpal-tunnel-2.mail.z | 1991-03-09 17:44 | 2.4K |
| carpal-tunnel.z | 1990-06-27 23:24 | 6.8K |
| cascade.tank.boom.z | 1991-12-01 02:59 | 2.5K |
| cdrom.life.z | 1992-05-31 19:15 | 1.1K |
| cerebus.pres.z | 1992-02-17 13:52 | 1.0K |
| chiropractor | 1993-06-19 21:40 | 375 |
| copyright.lossage.z | 1990-09-12 18:06 | 2.3K |
| crimes.against.z | 1990-11-01 00:52 | 689 |
| days.of.xmas.z | 1992-07-31 01:37 | 666 |
| death.of.romp | 1993-06-09 14:13 | 4.6K |
| decwars.txt.z | 1991-08-15 15:01 | 13K |
| dev.drum.z | 1990-11-08 21:08 | 1.6K |
| devouring.fungus.z | 1990-12-19 23:34 | 1.1K |
| divorce.phones.z | 1991-05-17 03:57 | 2.1K |
| dsi.map.nodes | 1993-04-29 04:37 | 2.8K |
| dvorak-layout.z | 1991-05-31 16:54 | 870 |
| easter.dates | 1993-05-03 02:00 | 23K |
| easter.math.z | 1992-07-04 22:44 | 723 |
| ecpa-flame.z | 1992-06-05 20:31 | 1.9K |
| egoboost.z | 1990-03-30 23:13 | 268 |
| eit.story.z | 1989-08-11 23:24 | 3.4K |
| electropress.z | 1992-04-14 18:52 | 896 |
| fermat.nyt | 1993-06-29 18:34 | 10K |
| first-aid.z | 1992-05-06 01:21 | 2.1K |
| flame.z | 1992-06-07 13:00 | 1.2K |
| flamingo.digest.z | 1991-11-21 23:31 | 1.7K |
| foia.text.z | 1990-03-03 14:58 | 5.8K |
| foot.shoot.z | 1990-07-17 15:42 | 2.7K |
| getabsdate.z | 1992-03-20 17:07 | 571 |
| gnulists.z | 1990-10-10 15:40 | 9.3K |
| goddess+computer.z | 1991-12-09 14:53 | 736 |
| grad-school-email | 1993-05-19 10:53 | 21K |
| halcion.z | 1992-02-21 09:52 | 2.2K |
| haylist | 1993-08-20 15:23 | 9.5K |
| hdtv.z | 1992-04-01 01:35 | 753 |
| iacocca.us.hosed.z | 1990-06-02 18:29 | 12K |
| icbm.z | 1992-04-01 11:13 | 1.1K |
| ice-cream-unix.mail.z | 1991-03-09 17:47 | 1.0K |
| iridium.z | 1990-08-06 11:34 | 9.4K |
| itsec.comments.z | 1990-09-26 03:27 | 3.2K |
| jik.oracle.z | 1991-12-31 21:04 | 1.2K |
| khoros-ptr.z | 1992-02-06 15:02 | 9.2K |
| khoros.z | 1992-04-01 01:40 | 9.3K |
| khors-fft.z | 1992-02-08 02:06 | 1.2K |
| klingon-font | 1993-05-14 15:25 | 1.0K |
| klingon.general.z | 1992-06-12 21:17 | 708 |
| klingonaase.txt.z | 1991-08-15 15:01 | 2.8K |
| krflame.z | 1992-04-26 13:42 | 1.0K |
| kwyjibo.z | 1992-06-19 23:53 | 519 |
| laser-tshirts.z | 1991-04-24 16:26 | 469 |
| leadin.z | 1990-03-25 02:52 | 40 |
| leadout.z | 1990-03-25 02:52 | 22 |
| lice-lice-baby.z | 1991-01-21 08:00 | 1.6K |
| lucky.charms.z | 1990-10-09 13:49 | 2.1K |
| mach.workshop.z | 1990-11-13 18:50 | 7.8K |
| math-purity-test.mail.z | 1991-04-21 11:25 | 2.0K |
| md5.pseudocollide | 1993-05-23 18:57 | 4.4K |
| modem.bs | 1993-05-31 16:18 | 6.6K |
| more-coke.z | 1992-02-16 11:18 | 1.3K |
| more.eit.z | 1991-10-31 18:03 | 1.5K |
| muse.schedule.z | 1990-10-12 15:40 | 1.4K |
| nemr.doc.z | 1990-08-16 02:06 | 2.4K |
| net.wedding | 1993-06-01 16:30 | 1.0K |
| next-intro.rfrench.z | 1990-09-28 13:16 | 12K |
| notaduck.z | 1992-05-14 03:38 | 1.0K |
| nukem.z | 1991-09-04 23:17 | 3.3K |
| null-pointer.z | 1992-03-11 02:34 | 1.0K |
| objetris.z | 1990-10-11 01:03 | 1.1K |
| paging.game.z | 1990-09-19 07:19 | 2.9K |
| peacenet.creditcards.z | 1991-05-28 13:36 | 1.0K |
| phonedata | 1993-08-25 22:36 | 554 |
| possible-goals-of-sipb.z | 1991-04-21 11:44 | 1.4K |
| powerout.z | 1991-04-01 02:11 | 1.7K |
| pp.z | 1991-12-02 23:00 | 379 |
| prarie-dog-slurp.z | 1992-01-27 15:53 | 1.8K |
| price | 1993-08-21 01:40 | 1.0K |
| proceeds.z | 1990-04-20 00:39 | 2.4K |
| pyro.z | 1990-08-19 05:08 | 10K |
| quantum.secure.z | 1990-07-14 17:30 | 2.1K |
| radio.lookup.z | 1991-03-11 23:09 | 557 |
| rainbow.books.z | 1990-11-26 15:45 | 538 |
| rat-soup.z | 1991-06-12 17:22 | 4.1K |
| real-programmers.new.z | 1990-03-21 20:29 | 3.0K |
| real.time.z | 1992-01-28 17:21 | 531 |
| refrigerator.death.z | 1990-03-15 20:26 | 1.3K |
| risks-rpm | 1993-05-18 18:44 | 1.8K |
| rspf.doc.z | 1992-02-16 11:03 | 3.5K |
| russian-code.z | 1991-02-02 06:39 | 631 |
| safire.punctuation.z | 1991-07-02 23:05 | 3.6K |
| samash | 1993-08-26 11:38 | 1.7K |
| sca.fbi.z | 1989-11-28 23:11 | 833 |
| scientology.z | 1992-06-17 10:17 | 1.7K |
| selection_svc.lossage.z | 1990-09-07 04:26 | 1.7K |
| sethg.plan.z | 1991-05-01 02:18 | 1.0K |
| simsong.book.blurb.z | 1991-04-30 22:07 | 5.1K |
| simsong.gnu.article.z | 1990-07-31 20:38 | 6.4K |
| snark-spook.z | 1992-04-03 02:08 | 9.8K |
| snpp.tex.mail.z | 1992-06-19 17:31 | 10K |
| spaf.shergold.z | 1992-03-18 22:55 | 2.6K |
| sr71.locations.z | 1991-05-04 06:37 | 1.6K |
| suan.z | 1990-09-20 17:49 | 1.5K |
| sun.cats.z | 1992-06-12 21:45 | 1.0K |
| sun.god.z | 1990-12-20 00:21 | 1.6K |
| sunset.z | 1990-11-08 23:24 | 498 |
| survival.lab.z | 1990-06-02 18:26 | 3.7K |
| tcp-compress.z | 1990-03-08 16:28 | 1.7K |
| tempest.bugs.z | 1991-08-08 01:05 | 4.0K |
| tep.god.z | 1990-11-10 07:36 | 3.2K |
| tj.crypt.z | 1991-04-20 23:32 | 371 |
| tops-10.z | 1992-03-16 01:11 | 470 |
| tops-20.z | 1992-07-19 18:06 | 1.5K |
| topten.z | 1992-03-06 16:46 | 14K |
| trek-vcr | 1993-05-08 12:08 | 3.0K |
| tuition.z | 1990-09-12 18:06 | 3.0K |
| unix-v6-pdp11.z | 1991-04-01 04:05 | 1.5K |
| unm-scons.z | 1992-03-15 10:24 | 2.9K |
| vax.bare.metal.z | 1992-07-31 01:54 | 14K |
| vm.jik.z | 1990-09-25 15:56 | 1.5K |
| wais-z39.50SPEC.z | 1991-08-13 01:24 | 31K |
| watson.quote | 1993-05-25 15:42 | 1.3K |
| we3quarks.z | 1990-12-11 09:22 | 1.7K |
| weather.z | 1991-07-02 09:36 | 576 |
| whitesatin.z | 1990-05-27 01:51 | 364 |
| writefax.man.z | 1992-07-04 21:12 | 5.3K |
| yard.plate.z | 1990-09-19 07:30 | 2.5K |
| ycode.z | 1991-02-02 07:00 | 4.6K |