![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
This content is being served through the AFS server rosebud.mit.edu in the sipb.mit.edu AFS cell. If you have any questions about this content, please contact the administrator of this directory, who made it publicly available. The administrators of the stuff.mit.edu AFS gateway are not responsible for this content and have no ability to remove it.
The administrator of this directory is geofft of sipb.mit.edu.
| Name | Last modified | Size |
|---|---|---|---|
| Parent Directory | - | |
| 389-admin-console/ | 2009-12-10 05:28 | - |
| 389-admin/ | 2009-12-10 05:28 | - |
| 389-adminutil/ | 2009-12-10 05:28 | - |
| 389-console/ | 2009-12-10 05:28 | - |
| 389-ds-base/ | 2009-12-10 05:28 | - |
| 389-ds-console/ | 2009-12-10 05:28 | - |
| 389-ds/ | 2009-12-10 05:28 | - |
| 389-dsgw/ | 2009-12-10 05:28 | - |
| Ajaxterm/ | 2009-12-10 05:28 | - |
| BackupPC/ | 2009-12-10 05:28 | - |
| BibTool/ | 2009-12-10 05:28 | - |
| CGSI-gSOAP/ | 2009-12-10 05:28 | - |
| DMitry/ | 2009-12-10 05:28 | - |
| Django/ | 2009-12-10 05:28 | - |
| FlightGear/ | 2009-12-10 05:28 | - |
| GLC_Player/ | 2009-12-10 05:28 | - |
| GLC_lib/ | 2009-12-10 05:28 | - |
| GMT-coastlines/ | 2009-12-10 05:28 | - |
| GMT-doc/ | 2009-12-10 05:28 | - |
| GMT/ | 2009-12-10 05:28 | - |
| GeoIP/ | 2009-12-10 05:28 | - |
| JSDoc/ | 2009-12-10 05:28 | - |
| Macaulay2/ | 2009-12-10 05:28 | - |
| MochiKit/ | 2009-12-10 05:28 | - |
| NetworkManager-vpnc/ | 2009-12-10 05:28 | - |
| OpenEXR/ | 2009-12-10 05:28 | - |
| Perlbal/ | 2009-12-10 05:28 | - |
| Pixie/ | 2009-12-10 05:28 | - |
| Pound/ | 2009-12-10 05:28 | - |
| PyYAML/ | 2009-12-10 05:28 | - |
| QuantLib/ | 2009-12-10 05:28 | - |
| R-DBI/ | 2009-12-10 05:28 | - |
| R-RM2/ | 2009-12-10 05:28 | - |
| R-RScaLAPACK/ | 2009-12-10 05:28 | - |
| R-biglm/ | 2009-12-10 05:28 | - |
| R-car/ | 2009-12-10 05:28 | - |
| R-hdf5/ | 2009-12-10 05:28 | - |
| R-lmtest/ | 2009-12-10 05:28 | - |
| R-msm/ | 2009-12-10 05:28 | - |
| R-nws/ | 2009-12-10 05:28 | - |
| R-qtl/ | 2009-12-10 05:28 | - |
| R-zoo/ | 2009-12-10 05:28 | - |
| R/ | 2009-12-10 05:28 | - |
| R2spec/ | 2009-12-10 05:28 | - |
| SDL_Pango/ | 2009-12-10 05:28 | - |
| SDL_gfx/ | 2009-12-10 05:28 | - |
| SDL_image/ | 2009-12-10 05:28 | - |
| SDL_mixer/ | 2009-12-10 05:28 | - |
| SDL_net/ | 2009-12-10 05:28 | - |
| SDL_ttf/ | 2009-12-10 05:28 | - |
| SIBsim4/ | 2009-12-10 05:28 | - |
| SimGear/ | 2009-12-10 05:28 | - |
| TurboGears/ | 2009-12-10 05:28 | - |
| aalib/ | 2009-12-10 05:28 | - |
| ack/ | 2009-12-10 05:28 | - |
| acpitool/ | 2009-12-10 05:28 | - |
| advancecomp/ | 2009-12-10 05:28 | - |
| agedu/ | 2009-12-10 05:28 | - |
| aget/ | 2009-12-10 05:28 | - |
| aiccu/ | 2009-12-10 05:28 | - |
| alpine/ | 2009-12-10 05:28 | - |
| alsamixergui/ | 2009-12-10 05:28 | - |
| altermime/ | 2009-12-10 05:28 | - |
| amanith/ | 2009-12-10 05:28 | - |
| amavisd-new/ | 2009-12-10 05:28 | - |
| animorph/ | 2009-12-10 05:28 | - |
| aoetools/ | 2009-12-10 05:28 | - |
| apachetop/ | 2009-12-10 05:28 | - |
| apcupsd/ | 2009-12-10 05:28 | - |
| apg/ | 2009-12-10 05:28 | - |
| apt-mirror/ | 2009-12-10 05:28 | - |
| apt/ | 2009-12-10 05:28 | - |
| aqbanking/ | 2009-12-10 05:28 | - |
| archivemail/ | 2009-12-10 05:28 | - |
| arj/ | 2009-12-10 05:28 | - |
| arp-scan/ | 2009-12-10 05:28 | - |
| artwiz-aleczapka-fonts/ | 2009-12-10 05:28 | - |
| asa/ | 2009-12-10 05:28 | - |
| asana-math-fonts/ | 2009-12-10 05:28 | - |
| asciidoc/ | 2009-12-10 05:28 | - |
| aspell-bn/ | 2009-12-10 05:28 | - |
| aspell-gu/ | 2009-12-10 05:28 | - |
| aspell-hi/ | 2009-12-10 05:28 | - |
| aspell-ml/ | 2009-12-10 05:28 | - |
| aspell-mr/ | 2009-12-10 05:28 | - |
| aspell-or/ | 2009-12-10 05:28 | - |
| aspell-pa/ | 2009-12-10 05:28 | - |
| aspell-sk/ | 2009-12-10 05:28 | - |
| aspell-ta/ | 2009-12-10 05:28 | - |
| aspell-te/ | 2009-12-10 05:28 | - |
| aterm/ | 2009-12-10 05:28 | - |
| atomix/ | 2009-12-10 05:28 | - |
| atop/ | 2009-12-10 05:28 | - |
| audio-entropyd/ | 2009-12-10 05:28 | - |
| augeas/ | 2009-12-17 20:44 | - |
| auto-destdir/ | 2009-12-10 05:28 | - |
| autodir/ | 2009-12-10 05:28 | - |
| awstats/ | 2009-12-10 05:28 | - |
| b43-tools/ | 2009-12-10 05:28 | - |
| bacula/ | 2009-12-10 05:28 | - |
| balance/ | 2009-12-10 05:28 | - |
| bandwidthd/ | 2009-12-10 05:28 | - |
| banner/ | 2009-12-10 05:28 | - |
| bash-completion/ | 2009-12-10 05:28 | - |
| bbkeys/ | 2009-12-10 05:28 | - |
| bcfg2/ | 2009-12-10 05:28 | - |
| bcrypt/ | 2009-12-10 05:28 | - |
| bea-stax/ | 2009-12-10 05:28 | - |
| beesu/ | 2009-12-10 05:28 | - |
| bibexport/ | 2009-12-10 05:28 | - |
| bind-libbind/ | 2009-12-10 05:28 | - |
| bios_extract/ | 2009-12-10 05:28 | - |
| biosdevname/ | 2009-12-10 05:28 | - |
| bitlbee/ | 2009-12-10 05:28 | - |
| blackbox/ | 2009-12-10 05:28 | - |
| blacs/ | 2009-12-10 05:28 | - |
| blender/ | 2009-12-10 05:28 | - |
| blitz/ | 2009-12-10 05:28 | - |
| blt/ | 2009-12-10 05:28 | - |
| bluefish/ | 2009-12-10 05:28 | - |
| bonnie++/ | 2009-12-10 05:28 | - |
| boolstuff/ | 2009-12-10 05:28 | - |
| bottlerocket/ | 2009-12-10 05:28 | - |
| brettfont-fonts/ | 2009-12-10 05:28 | - |
| bsdiff/ | 2009-12-10 05:28 | - |
| bugzilla/ | 2009-12-10 05:28 | - |
| bwidget/ | 2009-12-10 05:28 | - |
| bwm-ng/ | 2009-12-10 05:28 | - |
| c-ares/ | 2009-12-10 05:28 | - |
| cabextract/ | 2009-12-10 05:28 | - |
| cacti/ | 2009-12-10 05:28 | - |
| cairomm/ | 2009-12-10 05:28 | - |
| calamaris/ | 2009-12-10 05:28 | - |
| calcurse/ | 2009-12-10 05:28 | - |
| calendar/ | 2009-12-10 05:28 | - |
| camE/ | 2009-12-10 05:28 | - |
| cas/ | 2009-12-10 05:28 | - |
| catdoc/ | 2009-12-10 05:28 | - |
| ccrtp/ | 2009-12-10 05:28 | - |
| cdpr/ | 2009-12-10 05:28 | - |
| celestia/ | 2009-12-10 05:28 | - |
| celt/ | 2009-12-10 05:28 | - |
| cernlib/ | 2009-12-10 05:28 | - |
| certmaster/ | 2009-12-10 05:28 | - |
| cfengine/ | 2009-12-10 05:28 | - |
| cfitsio/ | 2009-12-10 05:28 | - |
| chameleon/ | 2009-12-10 05:28 | - |
| cherokee/ | 2009-12-10 05:28 | - |
| chkrootkit/ | 2009-12-10 05:28 | - |
| chmlib/ | 2009-12-10 05:28 | - |
| chrpath/ | 2009-12-10 05:28 | - |
| cim-schema/ | 2009-12-10 05:28 | - |
| cinepaint/ | 2009-12-10 05:28 | - |
| clamav/ | 2009-12-10 05:28 | - |
| claws-mail-plugins/ | 2009-12-10 05:28 | - |
| claws-mail/ | 2009-12-10 05:28 | - |
| clearsilver/ | 2009-12-10 05:28 | - |
| cmake/ | 2009-12-10 05:28 | - |
| cmospwd/ | 2009-12-10 05:28 | - |
| cmucl/ | 2009-12-10 05:28 | - |
| cobbler/ | 2009-12-10 05:28 | - |
| codeblocks/ | 2009-12-10 05:28 | - |
| collectl/ | 2009-12-10 05:28 | - |
| commoncpp2/ | 2009-12-10 05:28 | - |
| compat-wxGTK/ | 2009-12-10 05:28 | - |
| compat-wxPythonGTK2/ | 2009-12-10 05:28 | - |
| compface/ | 2009-12-10 05:28 | - |
| cone/ | 2009-12-10 05:28 | - |
| cowsay/ | 2009-12-10 05:28 | - |
| cpanspec/ | 2009-12-10 05:28 | - |
| cppunit/ | 2009-12-10 05:28 | - |
| cpqarrayd/ | 2009-12-10 05:28 | - |
| crack/ | 2009-12-10 05:28 | - |
| createrepo/ | 2009-12-10 05:28 | - |
| csmash/ | 2009-12-10 05:28 | - |
| csstidy/ | 2009-12-10 05:28 | - |
| csync2/ | 2009-12-10 05:28 | - |
| ctapi-common/ | 2009-12-10 05:28 | - |
| ctapi-cyberjack/ | 2009-12-10 05:28 | - |
| cups-pdf/ | 2009-12-10 05:28 | - |
| cvs2svn/ | 2009-12-10 05:28 | - |
| cvsgraph/ | 2009-12-10 05:28 | - |
| cvsplot/ | 2009-12-10 05:28 | - |
| cvsweb/ | 2009-12-10 05:28 | - |
| d4x/ | 2009-12-10 05:28 | - |
| daemonize/ | 2009-12-10 05:28 | - |
| dbench/ | 2009-12-10 05:28 | - |
| dc3dd/ | 2009-12-10 05:28 | - |
| dd_rescue/ | 2009-12-10 05:28 | - |
| ddclient/ | 2009-12-10 05:28 | - |
| ddd/ | 2009-12-10 05:28 | - |
| ddrescue/ | 2009-12-10 05:28 | - |
| debmirror/ | 2009-12-10 05:28 | - |
| debootstrap/ | 2009-12-10 05:28 | - |
| deltarpm/ | 2009-12-10 05:28 | - |
| denyhosts/ | 2009-12-10 05:28 | - |
| digitemp/ | 2009-12-10 05:28 | - |
| dirac/ | 2009-12-10 05:28 | - |
| dircproxy/ | 2009-12-10 05:28 | - |
| directfb/ | 2009-12-10 05:28 | - |
| django-authopenid/ | 2009-12-10 05:28 | - |
| djvulibre/ | 2009-12-10 05:28 | - |
| dkms/ | 2009-12-10 05:28 | - |
| dnsmasq/ | 2009-12-10 05:28 | - |
| dnstracer/ | 2009-12-10 05:28 | - |
| docbook2X/ | 2009-12-10 05:28 | - |
| docker/ | 2009-12-10 05:28 | - |
| dosbox/ | 2009-12-10 05:28 | - |
| drbdlinks/ | 2009-12-10 05:28 | - |
| drgeo-doc/ | 2009-12-10 05:28 | - |
| drgeo/ | 2009-12-10 05:28 | - |
| dropbear/ | 2009-12-10 05:28 | - |
| drupal/ | 2009-12-17 20:45 | - |
| dsniff/ | 2009-12-10 05:28 | - |
| dtc/ | 2009-12-10 05:28 | - |
| duplicity/ | 2009-12-10 05:28 | - |
| dvdisaster/ | 2009-12-10 05:28 | - |
| dwatch/ | 2009-12-10 05:28 | - |
| dx-samples/ | 2009-12-10 05:28 | - |
| dx/ | 2009-12-10 05:28 | - |
| easytag/ | 2009-12-10 05:28 | - |
| ebtables/ | 2009-12-10 05:28 | - |
| eggdrop/ | 2009-12-10 05:28 | - |
| emacs-nxml-mode/ | 2009-12-10 05:28 | - |
| enca/ | 2009-12-10 05:28 | - |
| enigma/ | 2009-12-10 05:28 | - |
| environment-modules/ | 2009-12-10 05:28 | - |
| epel-release/ | 2009-12-10 05:28 | - |
| epydoc/ | 2009-12-10 05:28 | - |
| erlang-eradius/ | 2009-12-10 05:28 | - |
| erlang-erlsom/ | 2009-12-10 05:28 | - |
| erlang-erlsyslog/ | 2009-12-10 05:28 | - |
| erlang-pgsql/ | 2009-12-10 05:28 | - |
| erlang/ | 2009-12-10 05:28 | - |
| esmtp/ | 2009-12-10 05:28 | - |
| ettercap/ | 2009-12-10 05:28 | - |
| eventlog/ | 2009-12-10 05:28 | - |
| evolution-bogofilter/ | 2009-12-10 05:28 | - |
| exiv2/ | 2009-12-10 05:28 | - |
| ez-ipupdate/ | 2009-12-10 05:28 | - |
| facter/ | 2009-12-10 05:28 | - |
| factory/ | 2009-12-10 05:28 | - |
| fail2ban/ | 2009-12-10 05:28 | - |
| fakechroot/ | 2009-12-10 05:28 | - |
| fakeroot/ | 2009-12-10 05:28 | - |
| fbreader/ | 2009-12-10 05:28 | - |
| fcode-utils/ | 2009-12-10 05:28 | - |
| fedora-package-config-apt/ | 2009-12-10 05:28 | - |
| fedora-package-config-smart/ | 2009-12-10 05:28 | - |
| fedora-packager/ | 2009-12-10 05:28 | - |
| fedora-usermgmt/ | 2009-12-10 05:28 | - |
| fftw/ | 2009-12-10 05:28 | - |
| fftw2/ | 2009-12-10 05:28 | - |
| fgfs-base/ | 2009-12-10 05:28 | - |
| filezilla/ | 2009-12-10 05:28 | - |
| fillets-ng-data/ | 2009-12-10 05:28 | - |
| fillets-ng/ | 2009-12-10 05:28 | - |
| firebird/ | 2009-12-10 05:28 | - |
| firehol/ | 2009-12-10 05:28 | - |
| firewalk/ | 2009-12-10 05:28 | - |
| firmware-addon-dell/ | 2009-12-10 05:28 | - |
| firmware-tools/ | 2009-12-10 05:28 | - |
| flam3/ | 2009-12-10 05:28 | - |
| flamerobin/ | 2009-12-10 05:28 | - |
| flashrom/ | 2009-12-10 05:28 | - |
| flasm/ | 2009-12-10 05:28 | - |
| flite/ | 2009-12-10 05:28 | - |
| fltk/ | 2009-12-10 05:28 | - |
| fluxbox/ | 2009-12-10 05:28 | - |
| fmtools/ | 2009-12-10 05:28 | - |
| fontforge/ | 2009-12-10 05:28 | - |
| fortune-mod/ | 2009-12-10 05:28 | - |
| fpc/ | 2009-12-10 05:28 | - |
| fping/ | 2009-12-10 05:28 | - |
| fprobe-ulog/ | 2009-12-10 05:28 | - |
| freealut/ | 2009-12-10 05:28 | - |
| freefont/ | 2009-12-10 05:28 | - |
| freehdl/ | 2009-12-10 05:28 | - |
| freehoo/ | 2009-12-10 05:28 | - |
| freetds/ | 2009-12-10 05:28 | - |
| freetennis/ | 2009-12-10 05:28 | - |
| freeze/ | 2009-12-10 05:28 | - |
| frozen-bubble/ | 2009-12-10 05:28 | - |
| fsvs/ | 2009-12-10 05:28 | - |
| ftnchek/ | 2009-12-10 05:28 | - |
| ftplib/ | 2009-12-10 05:28 | - |
| func/ | 2009-12-10 05:28 | - |
| fuse-gmailfs/ | 2009-12-10 05:28 | - |
| fuse/ | 2009-12-10 05:28 | - |
| fvwm/ | 2009-12-10 05:28 | - |
| fwrestart/ | 2009-12-10 05:28 | - |
| g-wrap/ | 2009-12-10 05:28 | - |
| g2clib/ | 2009-12-10 05:28 | - |
| gajim/ | 2009-12-10 05:28 | - |
| gambas/ | 2009-12-10 05:28 | - |
| gammu/ | 2009-12-10 05:28 | - |
| ganglia/ | 2009-12-10 05:28 | - |
| gc/ | 2009-12-10 05:28 | - |
| gcin/ | 2009-12-10 05:28 | - |
| gcombust/ | 2009-12-10 05:28 | - |
| gconfmm26/ | 2009-12-17 20:45 | - |
| gdal/ | 2009-12-10 05:28 | - |
| gdl/ | 2009-12-10 05:28 | - |
| gentoo/ | 2009-12-10 05:28 | - |
| geomview/ | 2009-12-10 05:28 | - |
| geos/ | 2009-12-10 05:28 | - |
| getdata/ | 2009-12-10 05:28 | - |
| ghex/ | 2009-12-10 05:28 | - |
| giblib/ | 2009-12-10 05:28 | - |
| git/ | 2009-12-10 05:28 | - |
| gkrellm-aclock/ | 2009-12-10 05:28 | - |
| gkrellm-freq/ | 2009-12-10 05:28 | - |
| gkrellm-moon/ | 2009-12-10 05:28 | - |
| gkrellm-sun/ | 2009-12-10 05:28 | - |
| gkrellm-top/ | 2009-12-10 05:28 | - |
| gl-117/ | 2009-12-10 05:28 | - |
| glew/ | 2009-12-10 05:28 | - |
| glibmm24/ | 2009-12-17 20:45 | - |
| globus-authz-callout-error/ | 2009-12-10 05:28 | - |
| globus-authz/ | 2009-12-10 05:28 | - |
| globus-callout/ | 2009-12-10 05:28 | - |
| globus-common/ | 2009-12-10 05:28 | - |
| globus-core/ | 2009-12-10 05:28 | - |
| globus-data-conversion/ | 2009-12-10 05:28 | - |
| globus-duct-common/ | 2009-12-10 05:28 | - |
| globus-duroc-common/ | 2009-12-10 05:28 | - |
| globus-ftp-client/ | 2009-12-10 05:28 | - |
| globus-ftp-control/ | 2009-12-10 05:28 | - |
| globus-gass-cache-program/ | 2009-12-10 05:28 | - |
| globus-gass-cache/ | 2009-12-10 05:28 | - |
| globus-gass-copy/ | 2009-12-10 05:28 | - |
| globus-gass-server-ez/ | 2009-12-10 05:28 | - |
| globus-gass-transfer/ | 2009-12-10 05:28 | - |
| globus-gatekeeper/ | 2009-12-10 05:28 | - |
| globus-gfork/ | 2009-12-10 05:28 | - |
| globus-gram-client/ | 2009-12-10 05:28 | - |
| globus-gram-job-manager-callout-error/ | 2009-12-10 05:28 | - |
| globus-gram-job-manager-scripts/ | 2009-12-10 05:28 | - |
| globus-gram-protocol/ | 2009-12-10 05:28 | - |
| globus-gridftp-server-control/ | 2009-12-10 05:28 | - |
| globus-gridftp-server/ | 2009-12-10 05:28 | - |
| globus-gsi-callback/ | 2009-12-10 05:28 | - |
| globus-gsi-cert-utils/ | 2009-12-10 05:28 | - |
| globus-gsi-credential/ | 2009-12-10 05:28 | - |
| globus-gsi-openssl-error/ | 2009-12-10 05:28 | - |
| globus-gsi-proxy-core/ | 2009-12-10 05:28 | - |
| globus-gsi-proxy-ssl/ | 2009-12-10 05:28 | - |
| globus-gsi-sysconfig/ | 2009-12-10 05:28 | - |
| globus-gss-assist/ | 2009-12-10 05:28 | - |
| globus-gssapi-error/ | 2009-12-10 05:28 | - |
| globus-gssapi-gsi/ | 2009-12-10 05:28 | - |
| globus-io/ | 2009-12-10 05:28 | - |
| globus-libtool/ | 2009-12-10 05:28 | - |
| globus-mp/ | 2009-12-10 05:28 | - |
| globus-nexus/ | 2009-12-10 05:28 | - |
| globus-openssl-module/ | 2009-12-10 05:28 | - |
| globus-openssl/ | 2009-12-10 05:28 | - |
| globus-proxy-utils/ | 2009-12-10 05:28 | - |
| globus-rls-client/ | 2009-12-10 05:28 | - |
| globus-rls-server/ | 2009-12-10 05:28 | - |
| globus-rsl-assist/ | 2009-12-10 05:28 | - |
| globus-rsl/ | 2009-12-10 05:28 | - |
| globus-scheduler-event-generator/ | 2009-12-10 05:28 | - |
| globus-usage/ | 2009-12-10 05:28 | - |
| globus-xio-gsi-driver/ | 2009-12-10 05:28 | - |
| globus-xio-popen-driver/ | 2009-12-10 05:28 | - |
| globus-xio/ | 2009-12-10 05:28 | - |
| glpi-data-injection/ | 2009-12-10 05:28 | - |
| glpi-mass-ocs-import/ | 2009-12-10 05:28 | - |
| glpi-pdf/ | 2009-12-10 05:28 | - |
| glpi/ | 2009-12-10 05:28 | - |
| glusterfs/ | 2009-12-10 05:28 | - |
| gmime/ | 2009-12-10 05:28 | - |
| gmrun/ | 2009-12-10 05:28 | - |
| gnome-screensaver-frogs/ | 2009-12-10 05:28 | - |
| gnome-vfsmm26/ | 2009-12-17 20:45 | - |
| gnu-smalltalk/ | 2009-12-10 05:28 | - |
| gnucash-docs/ | 2009-12-10 05:28 | - |
| gnucash/ | 2009-12-10 05:28 | - |
| gnustep-make/ | 2009-12-10 05:28 | - |
| gobby/ | 2009-12-10 05:28 | - |
| gocr/ | 2009-12-10 05:28 | - |
| google-perftools/ | 2009-12-10 05:28 | - |
| gperiodic/ | 2009-12-10 05:28 | - |
| grace/ | 2009-12-10 05:28 | - |
| grads/ | 2009-12-10 05:28 | - |
| graphviz/ | 2009-12-10 05:28 | - |
| grass/ | 2009-12-10 05:28 | - |
| greylistd/ | 2009-12-10 05:28 | - |
| grid-packaging-tools/ | 2009-12-10 05:28 | - |
| grip/ | 2009-12-10 05:28 | - |
| gromacs/ | 2009-12-10 05:28 | - |
| gshutdown/ | 2009-12-10 05:28 | - |
| gsl/ | 2009-12-10 05:28 | - |
| gsm/ | 2009-12-10 05:28 | - |
| gsoap/ | 2009-12-10 05:29 | - |
| gstreamer-python/ | 2009-12-10 05:29 | - |
| gtkmm24/ | 2009-12-17 20:45 | - |
| gtkwave/ | 2009-12-10 05:29 | - |
| gtranslator/ | 2009-12-10 05:29 | - |
| gtweakui/ | 2009-12-10 05:29 | - |
| guile-cairo/ | 2009-12-10 05:29 | - |
| guile-gnome-platform/ | 2009-12-10 05:29 | - |
| guile-lib/ | 2009-12-10 05:29 | - |
| gv/ | 2009-12-10 05:29 | - |
| gweled/ | 2009-12-10 05:29 | - |
| gwenhywfar/ | 2009-12-10 05:29 | - |
| gxemul/ | 2009-12-10 05:29 | - |
| gxine/ | 2009-12-10 05:29 | - |
| gyachi/ | 2009-12-10 05:29 | - |
| hackedbox/ | 2009-12-10 05:29 | - |
| halberd/ | 2009-12-10 05:29 | - |
| haproxy/ | 2009-12-10 05:29 | - |
| hatools/ | 2009-12-10 05:29 | - |
| hdf/ | 2009-12-10 05:29 | - |
| hdf5/ | 2009-12-10 05:29 | - |
| hercules/ | 2009-12-10 05:29 | - |
| highlight/ | 2009-12-10 05:29 | - |
| hmmer/ | 2009-12-10 05:29 | - |
| hspell/ | 2009-12-10 05:29 | - |
| html2text/ | 2009-12-10 05:29 | - |
| htmldoc/ | 2009-12-10 05:29 | - |
| htop/ | 2009-12-10 05:29 | - |
| i8kutils/ | 2009-12-10 05:29 | - |
| icecast/ | 2009-12-10 05:29 | - |
| icelandic-fonts/ | 2009-12-10 05:29 | - |
| icewm/ | 2009-12-10 05:29 | - |
| icu/ | 2009-12-10 05:29 | - |
| id3lib/ | 2009-12-10 05:29 | - |
| idesk/ | 2009-12-10 05:29 | - |
| idm-console-framework/ | 2009-12-10 05:29 | - |
| ifstatus/ | 2009-12-10 05:29 | - |
| iftop/ | 2009-12-10 05:29 | - |
| ike-scan/ | 2009-12-10 05:29 | - |
| iksemel/ | 2009-12-10 05:29 | - |
| ilmbase/ | 2009-12-10 05:29 | - |
| imlib2/ | 2009-12-10 05:29 | - |
| inadyn/ | 2009-12-10 05:29 | - |
| incron/ | 2009-12-10 05:29 | - |
| inkscape/ | 2009-12-10 05:29 | - |
| innotop/ | 2009-12-10 05:29 | - |
| international-time/ | 2009-12-10 05:29 | - |
| iozone/ | 2009-12-10 05:29 | - |
| ip6sic/ | 2009-12-10 05:29 | - |
| iperf/ | 2009-12-10 05:29 | - |
| ipw2100-firmware/ | 2009-12-10 05:29 | - |
| ipw2200-firmware/ | 2009-12-10 05:29 | - |
| ircd-hybrid/ | 2009-12-10 05:29 | - |
| irssi/ | 2009-12-10 05:29 | - |
| isic/ | 2009-12-10 05:29 | - |
| isync/ | 2009-12-10 05:29 | - |
| itcl/ | 2009-12-10 05:29 | - |
| itk/ | 2009-12-10 05:29 | - |
| iverilog/ | 2009-12-10 05:29 | - |
| iwidgets/ | 2009-12-10 05:29 | - |
| iwl4965-firmware/ | 2009-12-10 05:29 | - |
| iwl5000-firmware/ | 2009-12-10 05:29 | - |
| jabberpy/ | 2009-12-10 05:29 | - |
| jack-audio-connection-kit/ | 2009-12-10 05:29 | - |
| jam/ | 2009-12-10 05:29 | - |
| jasper/ | 2009-12-10 05:29 | - |
| java-1.6.0-openjdk/ | 2009-12-10 05:29 | - |
| jettison/ | 2009-12-10 05:29 | - |
| jigdo/ | 2009-12-10 05:29 | - |
| jnettop/ | 2009-12-10 05:29 | - |
| john/ | 2009-12-10 05:29 | - |
| js/ | 2009-12-10 05:29 | - |
| jss/ | 2009-12-10 05:29 | - |
| kannel/ | 2009-12-10 05:29 | - |
| kchmviewer/ | 2009-12-10 05:29 | - |
| kdesvn/ | 2009-12-10 05:29 | - |
| keepalived/ | 2009-12-10 05:29 | - |
| keychain/ | 2009-12-10 05:29 | - |
| keychecker/ | 2009-12-10 05:29 | - |
| khmeros-fonts/ | 2009-12-10 05:29 | - |
| koan/ | 2009-12-10 05:29 | - |
| koffice-langpack/ | 2009-12-10 05:29 | - |
| koffice/ | 2009-12-10 05:29 | - |
| kompose/ | 2009-12-10 05:29 | - |
| konversation/ | 2009-12-10 05:29 | - |
| kscope/ | 2009-12-10 05:29 | - |
| kst/ | 2009-12-10 05:29 | - |
| ksynaptics/ | 2009-12-10 05:29 | - |
| kyum/ | 2009-12-10 05:29 | - |
| ladvd/ | 2009-12-10 05:29 | - |
| lasi/ | 2009-12-10 05:29 | - |
| lazarus/ | 2009-12-10 05:29 | - |
| lcms/ | 2009-12-10 05:29 | - |
| lcov/ | 2009-12-10 05:29 | - |
| ldapvi/ | 2009-12-10 05:29 | - |
| libAfterImage/ | 2009-12-10 05:29 | - |
| libEMF/ | 2009-12-10 05:29 | - |
| libFoundation/ | 2009-12-10 05:29 | - |
| libapreq2/ | 2009-12-10 05:29 | - |
| libburn/ | 2009-12-10 05:29 | - |
| libcaca/ | 2009-12-10 05:29 | - |
| libcdaudio/ | 2009-12-10 05:29 | - |
| libcgi/ | 2009-12-10 05:29 | - |
| libconfuse/ | 2009-12-10 05:29 | - |
| libcue/ | 2009-12-10 05:29 | - |
| libdap/ | 2009-12-10 05:29 | - |
| libdnet/ | 2009-12-10 05:29 | - |
| libdockapp/ | 2009-12-10 05:29 | - |
| libesmtp/ | 2009-12-10 05:29 | - |
| libetpan/ | 2009-12-10 05:29 | - |
| libevent/ | 2009-12-10 05:29 | - |
| libextractor/ | 2009-12-10 05:29 | - |
| libfac/ | 2009-12-10 05:29 | - |
| libgeotiff/ | 2009-12-10 05:29 | - |
| libglademm24/ | 2009-12-17 20:45 | - |
| libgnomecanvasmm26/ | 2009-12-17 20:45 | - |
| libgnomemm26/ | 2009-12-17 20:45 | - |
| libgnomeuimm26/ | 2009-12-17 20:45 | - |
| libical/ | 2009-12-10 05:29 | - |
| libident/ | 2009-12-10 05:29 | - |
| libiptcdata/ | 2009-12-10 05:29 | - |
| libmcrypt/ | 2009-12-10 05:29 | - |
| libmicrohttpd/ | 2009-12-10 05:29 | - |
| libmp4v2/ | 2009-12-10 05:29 | - |
| libmpcdec/ | 2009-12-10 05:29 | - |
| libnc-dap/ | 2009-12-10 05:29 | - |
| libnet/ | 2009-12-10 05:29 | - |
| libnet10/ | 2009-12-10 05:29 | - |
| libnetdevname/ | 2009-12-10 05:29 | - |
| libnids/ | 2009-12-10 05:29 | - |
| libnss-mysql/ | 2009-12-10 05:29 | - |
| libofa/ | 2009-12-10 05:29 | - |
| libofx/ | 2009-12-10 05:29 | - |
| libopendaap/ | 2009-12-10 05:29 | - |
| libopm/ | 2009-12-10 05:29 | - |
| libpaper/ | 2009-12-10 05:29 | - |
| libpqxx/ | 2009-12-10 05:29 | - |
| librsync/ | 2009-12-10 05:29 | - |
| librx/ | 2009-12-10 05:29 | - |
| libsieve/ | 2009-12-10 05:29 | - |
| libsigc++20/ | 2009-12-10 05:29 | - |
| libsigsegv/ | 2009-12-10 05:29 | - |
| libsmbios/ | 2009-12-10 05:29 | - |
| libsndfile/ | 2009-12-10 05:29 | - |
| libssh2/ | 2009-12-10 05:29 | - |
| libstatgrab/ | 2009-12-10 05:29 | - |
| libsx/ | 2009-12-10 05:29 | - |
| libsynaptics/ | 2009-12-10 05:29 | - |
| libtar/ | 2009-12-10 05:29 | - |
| libtunepimp/ | 2009-12-10 05:29 | - |
| libuninameslist/ | 2009-12-10 05:29 | - |
| libupnp/ | 2009-12-10 05:29 | - |
| libvmime/ | 2009-12-10 05:29 | - |
| libvmime07/ | 2009-12-10 05:29 | - |
| libvpd/ | 2009-12-10 05:29 | - |
| libxml++/ | 2009-12-10 05:29 | - |
| libyahoo2/ | 2009-12-10 05:29 | - |
| libyaml/ | 2009-12-10 05:29 | - |
| limph/ | 2009-12-10 05:29 | - |
| lincity-ng/ | 2009-12-10 05:29 | - |
| linux_logo/ | 2009-12-10 05:29 | - |
| lmarbles/ | 2009-12-10 05:29 | - |
| log4cpp/ | 2009-12-10 05:29 | - |
| logjam/ | 2009-12-10 05:29 | - |
| logserial/ | 2009-12-10 05:29 | - |
| lout/ | 2009-12-10 05:29 | - |
| lshw/ | 2009-12-10 05:29 | - |
| lsscsi/ | 2009-12-10 05:29 | - |
| lua-filesystem/ | 2009-12-10 05:29 | - |
| lua/ | 2009-12-10 05:29 | - |
| lxappearance/ | 2009-12-10 05:29 | - |
| lxde-common/ | 2009-12-10 05:29 | - |
| lxde-settings-daemon/ | 2009-12-10 05:29 | - |
| lxinput/ | 2009-12-10 05:29 | - |
| lxlauncher/ | 2009-12-10 05:29 | - |
| lxmenu-data/ | 2009-12-10 05:29 | - |
| lxsession-edit/ | 2009-12-10 05:29 | - |
| lxshortcut/ | 2009-12-10 05:29 | - |
| lxsplit/ | 2009-12-10 05:29 | - |
| lxtask/ | 2009-12-10 05:29 | - |
| lxterminal/ | 2009-12-10 05:29 | - |
| lyx/ | 2009-12-10 05:29 | - |
| lzo/ | 2009-12-10 05:29 | - |
| lzop/ | 2009-12-10 05:29 | - |
| mail-notification/ | 2009-12-10 05:29 | - |
| maildrop/ | 2009-12-10 05:29 | - |
| makehuman/ | 2009-12-10 05:29 | - |
| mapserver/ | 2009-12-10 05:29 | - |
| mathml-fonts/ | 2009-12-10 05:29 | - |
| maxima/ | 2009-12-10 05:29 | - |
| mb2md/ | 2009-12-10 05:29 | - |
| mcabber/ | 2009-12-10 05:29 | - |
| mcrypt/ | 2009-12-10 05:29 | - |
| mdsplib/ | 2009-12-10 05:29 | - |
| mediawiki-ParserFunctions/ | 2009-12-10 05:29 | - |
| mediawiki-SpecialInterwiki/ | 2009-12-10 05:29 | - |
| mediawiki-semantic/ | 2009-12-10 05:29 | - |
| mediawiki/ | 2009-12-10 05:29 | - |
| memcached/ | 2009-12-10 05:29 | - |
| menu-cache/ | 2009-12-10 05:29 | - |
| mercurial/ | 2009-12-10 05:29 | - |
| metakit/ | 2009-12-10 05:29 | - |
| mfstools/ | 2009-12-10 05:29 | - |
| mhash/ | 2009-12-10 05:29 | - |
| mhgui/ | 2009-12-10 05:29 | - |
| miau/ | 2009-12-10 05:29 | - |
| milter-regex/ | 2009-12-10 05:29 | - |
| mimedefang/ | 2009-12-10 05:29 | - |
| mimetex/ | 2009-12-10 05:29 | - |
| mksh/ | 2009-12-10 05:29 | - |
| mldonkey/ | 2009-12-10 05:29 | - |
| mlmmj/ | 2009-12-10 05:29 | - |
| mock/ | 2009-12-10 05:29 | - |
| mod_auth_shadow/ | 2009-12-10 05:29 | - |
| mod_cband/ | 2009-12-10 05:29 | - |
| mod_evasive/ | 2009-12-10 05:29 | - |
| mod_extract_forwarded/ | 2009-12-10 05:29 | - |
| mod_fcgid/ | 2009-12-10 05:29 | - |
| mod_geoip/ | 2009-12-10 05:29 | - |
| mod_log_post/ | 2009-12-10 05:29 | - |
| mod_security/ | 2009-12-10 05:29 | - |
| mod_suphp/ | 2009-12-10 05:29 | - |
| mod_wsgi/ | 2009-12-10 05:29 | - |
| moin/ | 2009-12-10 05:29 | - |
| monit/ | 2009-12-10 05:29 | - |
| monitor-edid/ | 2009-12-10 05:29 | - |
| moodle/ | 2009-12-10 05:29 | - |
| moon-buggy/ | 2009-12-10 05:29 | - |
| moreutils/ | 2009-12-10 05:29 | - |
| mpich2/ | 2009-12-10 05:29 | - |
| mrepo/ | 2009-12-10 05:29 | - |
| ms-sys/ | 2009-12-10 05:29 | - |
| muParser/ | 2009-12-10 05:29 | - |
| munge/ | 2009-12-10 05:29 | - |
| munin/ | 2009-12-10 05:29 | - |
| mussh/ | 2009-12-10 05:29 | - |
| mydns/ | 2009-12-10 05:29 | - |
| myproxy/ | 2009-12-10 05:29 | - |
| mysql-proxy/ | 2009-12-10 05:29 | - |
| mysqlreport/ | 2009-12-10 05:29 | - |
| mysqltuner/ | 2009-12-10 05:29 | - |
| nagios-plugins-check_sip/ | 2009-12-10 05:29 | - |
| nagios-plugins/ | 2009-12-10 05:29 | - |
| nagios/ | 2009-12-10 05:29 | - |
| nail/ | 2009-12-10 05:29 | - |
| nas/ | 2009-12-10 05:29 | - |
| nbtscan/ | 2009-12-10 05:29 | - |
| ncarg/ | 2009-12-10 05:29 | - |
| ncftp/ | 2009-12-10 05:29 | - |
| ncrack/ | 2009-12-10 05:29 | - |
| net6/ | 2009-12-10 05:29 | - |
| netbsd-iscsi/ | 2009-12-10 05:29 | - |
| netcdf-decoders/ | 2009-12-10 05:29 | - |
| netcdf-perl/ | 2009-12-10 05:29 | - |
| netcdf/ | 2009-12-10 05:29 | - |
| netgo/ | 2009-12-10 05:29 | - |
| netstat-nat/ | 2009-12-10 05:29 | - |
| nettle/ | 2009-12-10 05:29 | - |
| nfswatch/ | 2009-12-10 05:29 | - |
| nginx/ | 2009-12-10 05:29 | - |
| ngircd/ | 2009-12-10 05:29 | - |
| nikto/ | 2009-12-10 05:29 | - |
| ninvaders/ | 2009-12-10 05:29 | - |
| nmh/ | 2009-12-10 05:29 | - |
| nocpulse-common/ | 2009-12-10 05:29 | - |
| noip/ | 2009-12-10 05:29 | - |
| nomarch/ | 2009-12-10 05:29 | - |
| nopaste/ | 2009-12-10 05:29 | - |
| nrg2iso/ | 2009-12-10 05:29 | - |
| nrpe/ | 2009-12-10 05:29 | - |
| nsca/ | 2009-12-10 05:29 | - |
| ntfs-3g/ | 2009-12-10 05:29 | - |
| ntfs-config/ | 2009-12-10 05:29 | - |
| ntfsprogs/ | 2009-12-10 05:29 | - |
| ntl/ | 2009-12-10 05:29 | - |
| numpy/ | 2009-12-10 05:29 | - |
| nut/ | 2009-12-10 05:29 | - |
| o3read/ | 2009-12-10 05:29 | - |
| obby/ | 2009-12-10 05:29 | - |
| ocaml-SDL/ | 2009-12-10 05:29 | - |
| ocaml-camlimages/ | 2009-12-10 05:29 | - |
| ocaml-findlib/ | 2009-12-10 05:29 | - |
| ocaml-gsl/ | 2009-12-10 05:29 | - |
| ocaml-omake/ | 2009-12-10 05:29 | - |
| ocaml/ | 2009-12-10 05:29 | - |
| ocsinventory-agent/ | 2009-12-10 05:29 | - |
| ocsinventory/ | 2009-12-10 05:29 | - |
| odfpy/ | 2009-12-10 05:29 | - |
| odt2txt/ | 2009-12-10 05:29 | - |
| oflb-smonohand-fonts/ | 2009-12-10 05:29 | - |
| ogdi/ | 2009-12-10 05:29 | - |
| oggvideotools/ | 2009-12-10 05:29 | - |
| oidentd/ | 2009-12-10 05:29 | - |
| oneko/ | 2009-12-10 05:29 | - |
| onesixtyone/ | 2009-12-10 05:29 | - |
| ooo2txt/ | 2009-12-10 05:29 | - |
| openal/ | 2009-12-10 05:29 | - |
| openalchemist/ | 2009-12-10 05:29 | - |
| opensaml/ | 2009-12-10 05:29 | - |
| openscada/ | 2009-12-10 05:29 | - |
| openser/ | 2009-12-10 05:29 | - |
| openvpn/ | 2009-12-10 05:29 | - |
| openwsman/ | 2009-12-10 05:29 | - |
| openxcap/ | 2009-12-10 05:29 | - |
| osslsigncode/ | 2009-12-10 05:29 | - |
| otrs/ | 2009-12-10 05:29 | - |
| ovaldi/ | 2009-12-10 05:29 | - |
| p7zip/ | 2009-12-10 05:29 | - |
| pam_abl/ | 2009-12-10 05:29 | - |
| pam_mysql/ | 2009-12-10 05:29 | - |
| pam_ssh/ | 2009-12-10 05:29 | - |
| paraview/ | 2009-12-10 05:29 | - |
| pastebin/ | 2009-12-10 05:29 | - |
| pbzip2/ | 2009-12-10 05:29 | - |
| pcapdiff/ | 2009-12-10 05:29 | - |
| pcapy/ | 2009-12-10 05:29 | - |
| pdfmerge/ | 2009-12-10 05:29 | - |
| pdns-recursor/ | 2009-12-10 05:29 | - |
| pdns/ | 2009-12-10 05:29 | - |
| pem/ | 2009-12-10 05:29 | - |
| pen/ | 2009-12-10 05:29 | - |
| perl-Affix-Infix2Postfix/ | 2009-12-10 05:29 | - |
| perl-Algorithm-Annotate/ | 2009-12-10 05:29 | - |
| perl-Algorithm-C3/ | 2009-12-10 05:29 | - |
| perl-Algorithm-CheckDigits/ | 2009-12-10 05:29 | - |
| perl-Algorithm-CurveFit/ | 2009-12-10 05:29 | - |
| perl-Algorithm-Diff/ | 2009-12-10 05:29 | - |
| perl-Alien-wxWidgets/ | 2009-12-10 05:29 | - |
| perl-AnyData/ | 2009-12-10 05:29 | - |
| perl-AnyEvent/ | 2009-12-10 05:29 | - |
| perl-Apache-DBI/ | 2009-12-10 05:29 | - |
| perl-Apache-Htpasswd/ | 2009-12-10 05:29 | - |
| perl-Apache-LogRegex/ | 2009-12-10 05:29 | - |
| perl-Apache-Session-Wrapper/ | 2009-12-10 05:29 | - |
| perl-Apache-Session/ | 2009-12-10 05:29 | - |
| perl-App-CLI/ | 2009-12-10 05:29 | - |
| perl-AppConfig/ | 2009-12-10 05:29 | - |
| perl-Archive-Extract/ | 2009-12-10 05:29 | - |
| perl-Archive-Tar/ | 2009-12-10 05:29 | - |
| perl-Archive-Zip/ | 2009-12-10 05:29 | - |
| perl-Array-Compare/ | 2009-12-10 05:29 | - |
| perl-Astro-FITS-CFITSIO/ | 2009-12-10 05:29 | - |
| perl-Authen-Krb5/ | 2009-12-10 05:29 | - |
| perl-Authen-PAM/ | 2009-12-10 05:29 | - |
| perl-Authen-SASL/ | 2009-12-10 05:29 | - |
| perl-BDB/ | 2009-12-10 05:29 | - |
| perl-BSD-Resource/ | 2009-12-10 05:29 | - |
| perl-BerkeleyDB/ | 2009-12-10 05:29 | - |
| perl-Boulder/ | 2009-12-10 05:29 | - |
| perl-Business-CreditCard/ | 2009-12-10 05:29 | - |
| perl-CGI-Session/ | 2009-12-10 05:29 | - |
| perl-CGI-Simple/ | 2009-12-10 05:29 | - |
| perl-CGI-SpeedyCGI/ | 2009-12-10 05:29 | - |
| perl-CGI-Untaint-date/ | 2009-12-10 05:29 | - |
| perl-CGI-Untaint-email/ | 2009-12-10 05:29 | - |
| perl-CGI-Untaint/ | 2009-12-10 05:29 | - |
| perl-CPAN-DistnameInfo/ | 2009-12-10 05:29 | - |
| perl-CPANPLUS/ | 2009-12-10 05:29 | - |
| perl-Cache-Cache/ | 2009-12-10 05:29 | - |
| perl-Cache-Memcached/ | 2009-12-10 05:29 | - |
| perl-Cache-Mmap/ | 2009-12-10 05:29 | - |
| perl-Cache/ | 2009-12-10 05:29 | - |
| perl-Cflow/ | 2009-12-10 05:29 | - |
| perl-Chart/ | 2009-12-10 05:29 | - |
| perl-Class-Accessor-Chained/ | 2009-12-10 05:29 | - |
| perl-Class-Accessor/ | 2009-12-10 05:29 | - |
| perl-Class-Autouse/ | 2009-12-10 05:29 | - |
| perl-Class-C3/ | 2009-12-10 05:29 | - |
| perl-Class-Container/ | 2009-12-10 05:29 | - |
| perl-Class-DBI-AbstractSearch/ | 2009-12-10 05:29 | - |
| perl-Class-DBI-AsForm/ | 2009-12-10 05:29 | - |
| perl-Class-DBI-FromCGI/ | 2009-12-10 05:29 | - |
| perl-Class-DBI-Loader-Relationship/ | 2009-12-10 05:29 | - |
| perl-Class-DBI-Loader/ | 2009-12-10 05:29 | - |
| perl-Class-DBI-Pager/ | 2009-12-10 05:29 | - |
| perl-Class-DBI-Pg/ | 2009-12-10 05:29 | - |
| perl-Class-DBI-Plugin-RetrieveAll/ | 2009-12-10 05:29 | - |
| perl-Class-DBI-Plugin-Type/ | 2009-12-10 05:29 | - |
| perl-Class-DBI-Plugin/ | 2009-12-10 05:29 | - |
| perl-Class-DBI-SQLite/ | 2009-12-10 05:29 | - |
| perl-Class-DBI-mysql/ | 2009-12-10 05:29 | - |
| perl-Class-DBI/ | 2009-12-10 05:29 | - |
| perl-Class-Data-Inheritable/ | 2009-12-10 05:29 | - |
| perl-Class-ErrorHandler/ | 2009-12-10 05:29 | - |
| perl-Class-Gomor/ | 2009-12-10 05:29 | - |
| perl-Class-Inner/ | 2009-12-10 05:29 | - |
| perl-Class-Inspector/ | 2009-12-10 05:29 | - |
| perl-Class-Loader/ | 2009-12-10 05:29 | - |
| perl-Class-MOP/ | 2009-12-10 05:29 | - |
| perl-Class-MethodMaker/ | 2009-12-10 05:29 | - |
| perl-Class-Singleton/ | 2009-12-10 05:29 | - |
| perl-Class-Trigger/ | 2009-12-10 05:29 | - |
| perl-Class-Whitehole/ | 2009-12-10 05:29 | - |
| perl-Clone/ | 2009-12-10 05:29 | - |
| perl-Color-Library/ | 2009-12-10 05:29 | - |
| perl-Compress-Raw-Bzip2/ | 2009-12-10 05:29 | - |
| perl-Compress-Raw-Zlib/ | 2009-12-10 05:29 | - |
| perl-Compress-Zlib/ | 2009-12-10 05:29 | - |
| perl-Config-IniFiles/ | 2009-12-10 05:29 | - |
| perl-Convert-ASCII-Armour/ | 2009-12-10 05:29 | - |
| perl-Convert-BinHex/ | 2009-12-10 05:29 | - |
| perl-Convert-PEM/ | 2009-12-10 05:29 | - |
| perl-Convert-TNEF/ | 2009-12-10 05:29 | - |
| perl-Convert-UUlib/ | 2009-12-10 05:29 | - |
| perl-Crypt-Blowfish/ | 2009-12-10 05:29 | - |
| perl-Crypt-CAST5_PP/ | 2009-12-10 05:29 | - |
| perl-Crypt-CBC/ | 2009-12-10 05:29 | - |
| perl-Crypt-DES/ | 2009-12-10 05:29 | - |
| perl-Crypt-DES_EDE3/ | 2009-12-10 05:29 | - |
| perl-Crypt-DH/ | 2009-12-10 05:29 | - |
| perl-Crypt-DSA/ | 2009-12-10 05:29 | - |
| perl-Crypt-GPG/ | 2009-12-10 05:29 | - |
| perl-Crypt-GeneratePassword/ | 2009-12-10 05:29 | - |
| perl-Crypt-OpenSSL-Bignum/ | 2009-12-10 05:29 | - |
| perl-Crypt-OpenSSL-RSA/ | 2009-12-10 05:29 | - |
| perl-Crypt-OpenSSL-Random/ | 2009-12-10 05:29 | - |
| perl-Crypt-PasswdMD5/ | 2009-12-10 05:29 | - |
| perl-Crypt-Primes/ | 2009-12-10 05:29 | - |
| perl-Crypt-RSA/ | 2009-12-10 05:29 | - |
| perl-Crypt-Random/ | 2009-12-10 05:29 | - |
| perl-Crypt-Rijndael/ | 2009-12-10 05:29 | - |
| perl-Crypt-SmbHash/ | 2009-12-10 05:29 | - |
| perl-Curses/ | 2009-12-10 05:29 | - |
| perl-DBD-AnyData/ | 2009-12-10 05:29 | - |
| perl-DBD-CSV/ | 2009-12-10 05:29 | - |
| perl-DBD-SQLite/ | 2009-12-10 05:29 | - |
| perl-DBD-SQLite2/ | 2009-12-10 05:29 | - |
| perl-DBIx-ContextualFetch/ | 2009-12-10 05:29 | - |
| perl-DBIx-SQLite-Simple/ | 2009-12-10 05:29 | - |
| perl-Danga-Socket/ | 2009-12-10 05:29 | - |
| perl-Data-Buffer/ | 2009-12-10 05:29 | - |
| perl-Data-Dump/ | 2009-12-10 05:29 | - |
| perl-Data-Hierarchy/ | 2009-12-10 05:29 | - |
| perl-Data-ICal/ | 2009-12-10 05:29 | - |
| perl-Data-Page/ | 2009-12-10 05:29 | - |
| perl-Data-Structure-Util/ | 2009-12-10 05:29 | - |
| perl-Date-ICal/ | 2009-12-10 05:29 | - |
| perl-Date-Leapyear/ | 2009-12-10 05:29 | - |
| perl-Date-Pcalc/ | 2009-12-10 05:29 | - |
| perl-Date-Simple/ | 2009-12-10 05:29 | - |
| perl-DateTime-Event-ICal/ | 2009-12-10 05:29 | - |
| perl-DateTime-Event-Recurrence/ | 2009-12-10 05:29 | - |
| perl-DateTime-Format-Excel/ | 2009-12-10 05:29 | - |
| perl-DateTime-Format-ICal/ | 2009-12-10 05:29 | - |
| perl-DateTime-Format-Mail/ | 2009-12-10 05:29 | - |
| perl-DateTime-Format-Strptime/ | 2009-12-10 05:29 | - |
| perl-DateTime-Format-W3CDTF/ | 2009-12-10 05:29 | - |
| perl-DateTime-Precise/ | 2009-12-10 05:29 | - |
| perl-DateTime-Set/ | 2009-12-10 05:29 | - |
| perl-DateTime/ | 2009-12-10 05:29 | - |
| perl-Devel-Caller/ | 2009-12-10 05:29 | - |
| perl-Devel-Cover/ | 2009-12-10 05:29 | - |
| perl-Devel-Leak/ | 2009-12-10 05:29 | - |
| perl-Devel-Profiler/ | 2009-12-10 05:29 | - |
| perl-Devel-Symdump/ | 2009-12-10 05:29 | - |
| perl-Device-SerialPort/ | 2009-12-10 05:29 | - |
| perl-Digest-BubbleBabble/ | 2009-12-10 05:29 | - |
| perl-Digest-MD2/ | 2009-12-10 05:29 | - |
| perl-Digest-MD4/ | 2009-12-10 05:29 | - |
| perl-Email-Abstract/ | 2009-12-10 05:29 | - |
| perl-Email-Date-Format/ | 2009-12-10 05:29 | - |
| perl-Email-Date/ | 2009-12-10 05:29 | - |
| perl-Email-Find/ | 2009-12-10 05:29 | - |
| perl-Email-MIME-Attachment-Stripper/ | 2009-12-10 05:29 | - |
| perl-Email-MIME-Creator/ | 2009-12-10 05:29 | - |
| perl-Email-Reply/ | 2009-12-10 05:29 | - |
| perl-Email-Send/ | 2009-12-10 05:29 | - |
| perl-Email-Simple-Creator/ | 2009-12-10 05:29 | - |
| perl-Email-Valid/ | 2009-12-10 05:29 | - |
| perl-Encode-Detect/ | 2009-12-10 05:29 | - |
| perl-Event-ExecFlow/ | 2009-12-10 05:29 | - |
| perl-Event-Lib/ | 2009-12-10 05:29 | - |
| perl-Event-RPC/ | 2009-12-10 05:29 | - |
| perl-Event/ | 2009-12-10 05:29 | - |
| perl-Exception-Class/ | 2009-12-10 05:29 | - |
| perl-Exporter-Lite/ | 2009-12-10 05:29 | - |
| perl-ExtUtils-CBuilder/ | 2009-12-10 05:29 | - |
| perl-ExtUtils-F77/ | 2009-12-10 05:29 | - |
| perl-ExtUtils-ParseXS/ | 2009-12-10 05:29 | - |
| perl-ExtUtils-PkgConfig/ | 2009-12-10 05:29 | - |
| perl-ExtUtils-XSBuilder/ | 2009-12-10 05:29 | - |
| perl-Feed-Find/ | 2009-12-10 05:29 | - |
| perl-File-BOM/ | 2009-12-10 05:29 | - |
| perl-File-BaseDir/ | 2009-12-10 05:29 | - |
| perl-File-Copy-Recursive/ | 2009-12-10 05:29 | - |
| perl-File-DesktopEntry/ | 2009-12-10 05:29 | - |
| perl-File-Fetch/ | 2009-12-10 05:29 | - |
| perl-File-Find-Rule/ | 2009-12-10 05:29 | - |
| perl-File-MMagic-XS/ | 2009-12-10 05:29 | - |
| perl-File-MMagic/ | 2009-12-10 05:29 | - |
| perl-File-MimeInfo/ | 2009-12-10 05:29 | - |
| perl-File-NFSLock/ | 2009-12-10 05:29 | - |
| perl-File-Next/ | 2009-12-10 05:29 | - |
| perl-File-ReadBackwards/ | 2009-12-10 05:29 | - |
| perl-File-Remove/ | 2009-12-10 05:29 | - |
| perl-File-RsyncP/ | 2009-12-10 05:29 | - |
| perl-File-Sync/ | 2009-12-10 05:29 | - |
| perl-File-Tail/ | 2009-12-10 05:29 | - |
| perl-File-Type/ | 2009-12-10 05:29 | - |
| perl-File-Which/ | 2009-12-10 05:29 | - |
| perl-File-chdir/ | 2009-12-10 05:29 | - |
| perl-Filesys-Df/ | 2009-12-10 05:29 | - |
| perl-Finance-Quote/ | 2009-12-10 05:29 | - |
| perl-FreezeThaw/ | 2009-12-10 05:29 | - |
| perl-Frontier-RPC/ | 2009-12-10 05:29 | - |
| perl-GD/ | 2009-12-10 05:29 | - |
| perl-GDGraph/ | 2009-12-10 05:29 | - |
| perl-GDTextUtil/ | 2009-12-10 05:29 | - |
| perl-GSSAPI/ | 2009-12-10 05:29 | - |
| perl-Gearman-Client-Async/ | 2009-12-10 05:29 | - |
| perl-Gearman-Server/ | 2009-12-10 05:29 | - |
| perl-Gearman/ | 2009-12-10 05:29 | - |
| perl-Geo-IP/ | 2009-12-10 05:29 | - |
| perl-Geography-Countries/ | 2009-12-10 05:29 | - |
| perl-GnuPG-Interface/ | 2009-12-10 05:29 | - |
| perl-Graphics-ColorNames/ | 2009-12-10 05:29 | - |
| perl-Gtk2-Ex-FormFactory/ | 2009-12-10 05:29 | - |
| perl-HTML-FormatText-WithLinks/ | 2009-12-10 05:29 | - |
| perl-HTML-FromText/ | 2009-12-10 05:29 | - |
| perl-HTML-Mason/ | 2009-12-10 05:29 | - |
| perl-HTML-Parser/ | 2009-12-10 05:29 | - |
| perl-HTML-PrettyPrinter/ | 2009-12-10 05:29 | - |
| perl-HTML-Prototype/ | 2009-12-10 05:29 | - |
| perl-HTML-Scrubber/ | 2009-12-10 05:29 | - |
| perl-HTML-Table/ | 2009-12-10 05:29 | - |
| perl-HTML-TableExtract/ | 2009-12-10 05:29 | - |
| perl-HTML-Template-Expr/ | 2009-12-10 05:29 | - |
| perl-HTML-Template-Pro/ | 2009-12-10 05:29 | - |
| perl-HTML-Template/ | 2009-12-10 05:29 | - |
| perl-HTML-Tree/ | 2009-12-10 05:29 | - |
| perl-HTTP-Body/ | 2009-12-10 05:29 | - |
| perl-HTTP-BrowserDetect/ | 2009-12-10 05:29 | - |
| perl-HTTP-Cache-Transparent/ | 2009-12-10 05:29 | - |
| perl-HTTP-DAV/ | 2009-12-10 05:29 | - |
| perl-HTTP-Daemon-SSL/ | 2009-12-10 05:29 | - |
| perl-HTTP-Server-Simple/ | 2009-12-10 05:29 | - |
| perl-Hash-Merge/ | 2009-12-10 05:29 | - |
| perl-Heap/ | 2009-12-10 05:29 | - |
| perl-IO-AIO/ | 2009-12-10 05:29 | - |
| perl-IO-All/ | 2009-12-10 05:29 | - |
| perl-IO-Capture/ | 2009-12-10 05:29 | - |
| perl-IO-CaptureOutput/ | 2009-12-10 05:29 | - |
| perl-IO-Compress-Base/ | 2009-12-10 05:29 | - |
| perl-IO-Compress-Bzip2/ | 2009-12-10 05:29 | - |
| perl-IO-Compress-Zlib/ | 2009-12-10 05:29 | - |
| perl-IO-Digest/ | 2009-12-10 05:29 | - |
| perl-IO-Interface/ | 2009-12-10 05:29 | - |
| perl-IO-Null/ | 2009-12-10 05:29 | - |
| perl-IO-Socket-SSL/ | 2009-12-10 05:29 | - |
| perl-IO-String/ | 2009-12-10 05:29 | - |
| perl-IO-Tty/ | 2009-12-10 05:29 | - |
| perl-IO-Zlib/ | 2009-12-10 05:29 | - |
| perl-IO-stringy/ | 2009-12-10 05:29 | - |
| perl-IPC-Cmd/ | 2009-12-10 05:29 | - |
| perl-IPC-DirQueue/ | 2009-12-10 05:29 | - |
| perl-IPC-Run/ | 2009-12-10 05:29 | - |
| perl-IPC-ShareLite/ | 2009-12-10 05:29 | - |
| perl-IPC-Shareable/ | 2009-12-10 05:29 | - |
| perl-IPC-SharedCache/ | 2009-12-10 05:29 | - |
| perl-Ima-DBI/ | 2009-12-10 05:29 | - |
| perl-Image-ExifTool/ | 2009-12-10 05:29 | - |
| perl-Image-Math-Constrain/ | 2009-12-10 05:29 | - |
| perl-Imager/ | 2009-12-10 05:29 | - |
| perl-Inline-Files/ | 2009-12-10 05:29 | - |
| perl-Inline/ | 2009-12-10 05:29 | - |
| perl-Jcode/ | 2009-12-10 05:29 | - |
| perl-Kwiki-Archive-Rcs/ | 2009-12-10 05:29 | - |
| perl-Kwiki-Attachments/ | 2009-12-10 05:29 | - |
| perl-Kwiki-Diff/ | 2009-12-10 05:29 | - |
| perl-Kwiki-ModPerl/ | 2009-12-10 05:29 | - |
| perl-Kwiki-NewPage/ | 2009-12-10 05:29 | - |
| perl-Kwiki-Raw/ | 2009-12-10 05:29 | - |
| perl-Kwiki-RecentChanges/ | 2009-12-10 05:29 | - |
| perl-Kwiki-Revisions/ | 2009-12-10 05:29 | - |
| perl-Kwiki-Search/ | 2009-12-10 05:29 | - |
| perl-Kwiki-UserName/ | 2009-12-10 05:29 | - |
| perl-Kwiki-UserPreferences/ | 2009-12-10 05:29 | - |
| perl-Kwiki-Users-Remote/ | 2009-12-10 05:29 | - |
| perl-Kwiki/ | 2009-12-10 05:29 | - |
| perl-LWP-Authen-Wsse/ | 2009-12-10 05:29 | - |
| perl-Lingua-EN-Inflect-Number/ | 2009-12-10 05:29 | - |
| perl-Lingua-EN-Inflect/ | 2009-12-10 05:29 | - |
| perl-Lingua-EN-Numbers-Ordinate/ | 2009-12-10 05:29 | - |
| perl-Lingua-Preferred/ | 2009-12-10 05:29 | - |
| perl-Linux-Pid/ | 2009-12-10 05:29 | - |
| perl-Locale-Maketext-Fuzzy/ | 2009-12-10 05:29 | - |
| perl-Locale-Maketext-Gettext/ | 2009-12-10 05:29 | - |
| perl-Locale-Maketext-Simple/ | 2009-12-10 05:29 | - |
| perl-LockFile-Simple/ | 2009-12-10 05:29 | - |
| perl-Log-Dispatch-FileRotate/ | 2009-12-10 05:29 | - |
| perl-Log-Dispatch/ | 2009-12-10 05:29 | - |
| perl-Log-Log4perl/ | 2009-12-10 05:29 | - |
| perl-Log-Message-Simple/ | 2009-12-10 05:29 | - |
| perl-Log-Message/ | 2009-12-10 05:29 | - |
| perl-Log-TraceMessages/ | 2009-12-10 05:29 | - |
| perl-Log-Trivial/ | 2009-12-10 05:29 | - |
| perl-MD5/ | 2009-12-10 05:29 | - |
| perl-MIME-Lite/ | 2009-12-10 05:29 | - |
| perl-MIME-Types/ | 2009-12-10 05:29 | - |
| perl-MIME-tools/ | 2009-12-10 05:29 | - |
| perl-MLDBM/ | 2009-12-10 05:29 | - |
| perl-Mail-Alias/ | 2009-12-10 05:29 | - |
| perl-Mail-Box-Parser-C/ | 2009-12-10 05:29 | - |
| perl-Mail-Box/ | 2009-12-10 05:29 | - |
| perl-Mail-IMAPClient/ | 2009-12-10 05:29 | - |
| perl-Mail-SPF-Query/ | 2009-12-10 05:29 | - |
| perl-Mail-SPF/ | 2009-12-10 05:29 | - |
| perl-Mail-Sender/ | 2009-12-10 05:29 | - |
| perl-Mail-Sendmail/ | 2009-12-10 05:29 | - |
| perl-Mail-Transport-Dbx/ | 2009-12-10 05:29 | - |
| perl-MailTools/ | 2009-12-10 05:29 | - |
| perl-MasonX-Interp-WithCallbacks/ | 2009-12-10 05:29 | - |
| perl-Math-Base85/ | 2009-12-10 05:29 | - |
| perl-Math-BaseCnv/ | 2009-12-10 05:29 | - |
| perl-Math-BigInt-GMP/ | 2009-12-17 20:46 | - |
| perl-Math-FFT/ | 2009-12-10 05:29 | - |
| perl-Math-GMP/ | 2009-12-10 05:29 | - |
| perl-Math-MatrixReal/ | 2009-12-10 05:29 | - |
| perl-Math-Pari/ | 2009-12-10 05:29 | - |
| perl-Math-Symbolic/ | 2009-12-10 05:29 | - |
| perl-Maypole/ | 2009-12-10 05:29 | - |
| perl-Module-Build/ | 2009-12-10 05:29 | - |
| perl-Module-Compile/ | 2009-12-10 05:29 | - |
| perl-Module-CoreList/ | 2009-12-10 05:29 | - |
| perl-Module-Depends/ | 2009-12-10 05:29 | - |
| perl-Module-Info/ | 2009-12-10 05:29 | - |
| perl-Module-Install/ | 2009-12-10 05:29 | - |
| perl-Module-Load-Conditional/ | 2009-12-10 05:29 | - |
| perl-Module-Load/ | 2009-12-10 05:29 | - |
| perl-Module-Loaded/ | 2009-12-10 05:29 | - |
| perl-Module-Pluggable/ | 2009-12-10 05:29 | - |
| perl-Module-ScanDeps/ | 2009-12-10 05:29 | - |
| perl-Module-Signature/ | 2009-12-10 05:29 | - |
| perl-MogileFS-Client/ | 2009-12-10 05:29 | - |
| perl-MogileFS-Utils/ | 2009-12-10 05:29 | - |
| perl-NOCpulse-CLAC/ | 2009-12-10 05:29 | - |
| perl-NOCpulse-Debug/ | 2009-12-10 05:29 | - |
| perl-NOCpulse-Gritch/ | 2009-12-10 05:29 | - |
| perl-NOCpulse-Object/ | 2009-12-10 05:29 | - |
| perl-NOCpulse-SetID/ | 2009-12-10 05:29 | - |
| perl-NOCpulse-Utils/ | 2009-12-10 05:29 | - |
| perl-Net-CIDR-Lite/ | 2009-12-10 05:29 | - |
| perl-Net-DNS-Resolver-Programmable/ | 2009-12-10 05:29 | - |
| perl-Net-Daemon/ | 2009-12-10 05:29 | - |
| perl-Net-Domain-TLD/ | 2009-12-10 05:29 | - |
| perl-Net-FTPServer/ | 2009-12-10 05:29 | - |
| perl-Net-IP-CMatch/ | 2009-12-10 05:29 | - |
| perl-Net-IP/ | 2009-12-10 05:29 | - |
| perl-Net-IPv4Addr/ | 2009-12-10 05:29 | - |
| perl-Net-IPv6Addr/ | 2009-12-10 05:29 | - |
| perl-Net-LibIDN/ | 2009-12-10 05:29 | - |
| perl-Net-Libdnet/ | 2009-12-10 05:29 | - |
| perl-Net-Packet/ | 2009-12-10 05:29 | - |
| perl-Net-Patricia/ | 2009-12-10 05:29 | - |
| perl-Net-Pcap/ | 2009-12-10 05:29 | - |
| perl-Net-SCP/ | 2009-12-10 05:29 | - |
| perl-Net-SFTP/ | 2009-12-10 05:29 | - |
| perl-Net-SNMP/ | 2009-12-10 05:29 | - |
| perl-Net-SSH-Perl/ | 2009-12-10 05:29 | - |
| perl-Net-SSH/ | 2009-12-10 05:29 | - |
| perl-Net-SSLeay/ | 2009-12-10 05:29 | - |
| perl-Net-Server/ | 2009-12-10 05:29 | - |
| perl-Net-Telnet/ | 2009-12-10 05:29 | - |
| perl-Net-Write/ | 2009-12-10 05:29 | - |
| perl-Net-eBay/ | 2009-12-10 05:29 | - |
| perl-NetAddr-IP/ | 2009-12-10 05:29 | - |
| perl-Nmap-Parser/ | 2009-12-10 05:29 | - |
| perl-Number-Compare/ | 2009-12-10 05:29 | - |
| perl-OLE-Storage_Lite/ | 2009-12-10 05:29 | - |
| perl-Object-Accessor/ | 2009-12-10 05:29 | - |
| perl-Object-MultiType/ | 2009-12-10 05:29 | - |
| perl-Object-Realize-Later/ | 2009-12-10 05:29 | - |
| perl-OpenFrame/ | 2009-12-10 05:29 | - |
| perl-PAR-Dist/ | 2009-12-10 05:29 | - |
| perl-PDF-Create/ | 2009-12-10 05:29 | - |
| perl-POE/ | 2009-12-10 05:29 | - |
| perl-PPI-HTML/ | 2009-12-10 05:29 | - |
| perl-PPI/ | 2009-12-10 05:29 | - |
| perl-Package-Constants/ | 2009-12-10 05:29 | - |
| perl-Params-CallbackRequest/ | 2009-12-10 05:29 | - |
| perl-Params-Check/ | 2009-12-10 05:29 | - |
| perl-Params-Coerce/ | 2009-12-10 05:29 | - |
| perl-Params-Validate/ | 2009-12-10 05:29 | - |
| perl-Parse-CPAN-Meta/ | 2009-12-10 05:29 | - |
| perl-Parse-CPAN-Packages/ | 2009-12-10 05:29 | - |
| perl-Parse-RecDescent/ | 2009-12-10 05:29 | - |
| perl-Parse-Yapp/ | 2009-12-10 05:29 | - |
| perl-ParseLex/ | 2009-12-10 05:29 | - |
| perl-Path-Class/ | 2009-12-10 05:29 | - |
| perl-Perl6-Bible/ | 2009-12-10 05:29 | - |
| perl-PerlIO-eol/ | 2009-12-10 05:29 | - |
| perl-PerlIO-via-dynamic/ | 2009-12-10 05:29 | - |
| perl-PerlIO-via-symlink/ | 2009-12-10 05:29 | - |
| perl-Perlbal-XS-HTTPHeaders/ | 2009-12-10 05:29 | - |
| perl-Pipeline/ | 2009-12-10 05:29 | - |
| perl-Pod-Coverage/ | 2009-12-10 05:29 | - |
| perl-Pod-Escapes/ | 2009-12-10 05:29 | - |
| perl-Pod-POM/ | 2009-12-10 05:29 | - |
| perl-Pod-Readme/ | 2009-12-10 05:29 | - |
| perl-Pod-Simple/ | 2009-12-10 05:29 | - |
| perl-Proc-Daemon/ | 2009-12-10 05:29 | - |
| perl-Proc-ProcessTable/ | 2009-12-10 05:29 | - |
| perl-Pugs-Compiler-Rule/ | 2009-12-10 05:29 | - |
| perl-RPM2/ | 2009-12-10 05:29 | - |
| perl-Razor-Agent/ | 2009-12-10 05:29 | - |
| perl-Readonly-XS/ | 2009-12-10 05:29 | - |
| perl-Readonly/ | 2009-12-10 05:29 | - |
| perl-Return-Value/ | 2009-12-10 05:29 | - |
| perl-SOAP-Lite/ | 2009-12-10 05:29 | - |
| perl-SQL-Abstract-Limit/ | 2009-12-10 05:29 | - |
| perl-SQL-Abstract/ | 2009-12-10 05:29 | - |
| perl-SQLite-Simple/ | 2009-12-10 05:29 | - |
| perl-SUPER/ | 2009-12-10 05:29 | - |
| perl-SVK/ | 2009-12-10 05:29 | - |
| perl-SVN-Mirror/ | 2009-12-10 05:29 | - |
| perl-SVN-Simple/ | 2009-12-10 05:29 | - |
| perl-Satcon/ | 2009-12-10 05:29 | - |
| perl-Schedule-Cron-Events/ | 2009-12-10 05:29 | - |
| perl-Set-Crontab/ | 2009-12-10 05:29 | - |
| perl-Set-Infinite/ | 2009-12-10 05:29 | - |
| perl-Smart-Comments/ | 2009-12-10 05:29 | - |
| perl-Socket6/ | 2009-12-10 05:29 | - |
| perl-Sort-Versions/ | 2009-12-10 05:29 | - |
| perl-Spiffy/ | 2009-12-10 05:29 | - |
| perl-Spoon/ | 2009-12-10 05:29 | - |
| perl-Spreadsheet-ParseExcel/ | 2009-12-10 05:29 | - |
| perl-Spreadsheet-WriteExcel/ | 2009-12-10 05:29 | - |
| perl-Statistics-Descriptive/ | 2009-12-10 05:29 | - |
| perl-String-Approx/ | 2009-12-10 05:29 | - |
| perl-String-CRC32/ | 2009-12-10 05:29 | - |
| perl-String-ShellQuote/ | 2009-12-10 05:29 | - |
| perl-Sub-Identify/ | 2009-12-10 05:29 | - |
| perl-Sub-Install/ | 2009-12-10 05:29 | - |
| perl-Sub-Name/ | 2009-12-10 05:29 | - |
| perl-Sub-Uplevel/ | 2009-12-10 05:29 | - |
| perl-Sys-Syscall/ | 2009-12-10 05:29 | - |
| perl-Sys-Virt/ | 2009-12-10 05:29 | - |
| perl-TAP-Harness/ | 2009-12-10 05:29 | - |
| perl-Taint-Runtime/ | 2009-12-10 05:29 | - |
| perl-Template-GD/ | 2009-12-10 05:29 | - |
| perl-Template-Plugin-Class/ | 2009-12-10 05:29 | - |
| perl-Template-Toolkit/ | 2009-12-10 05:29 | - |
| perl-Term-ReadPassword/ | 2009-12-10 05:29 | - |
| perl-Term-UI/ | 2009-12-10 05:29 | - |
| perl-TermReadKey/ | 2009-12-10 05:29 | - |
| perl-Test-Base/ | 2009-12-10 05:29 | - |
| perl-Test-Builder-Tester/ | 2009-12-10 05:29 | - |
| perl-Test-CPAN-Meta/ | 2009-12-10 05:29 | - |
| perl-Test-Class/ | 2009-12-10 05:29 | - |
| perl-Test-Cmd/ | 2009-12-10 05:29 | - |
| perl-Test-Deep/ | 2009-12-10 05:29 | - |
| perl-Test-Distribution/ | 2009-12-10 05:29 | - |
| perl-Test-Exception/ | 2009-12-10 05:29 | - |
| perl-Test-File-Contents/ | 2009-12-10 05:29 | - |
| perl-Test-File/ | 2009-12-10 05:29 | - |
| perl-Test-Manifest/ | 2009-12-10 05:29 | - |
| perl-Test-MockModule/ | 2009-12-10 05:29 | - |
| perl-Test-NoWarnings/ | 2009-12-10 05:29 | - |
| perl-Test-Object/ | 2009-12-10 05:29 | - |
| perl-Test-Output/ | 2009-12-10 05:29 | - |
| perl-Test-Pod-Coverage/ | 2009-12-10 05:29 | - |
| perl-Test-Pod/ | 2009-12-10 05:29 | - |
| perl-Test-Portability-Files/ | 2009-12-10 05:29 | - |
| perl-Test-Prereq/ | 2009-12-10 05:29 | - |
| perl-Test-Taint/ | 2009-12-10 05:29 | - |
| perl-Test-Tester/ | 2009-12-10 05:29 | - |
| perl-Test-Unit/ | 2009-12-10 05:29 | - |
| perl-Text-Aspell/ | 2009-12-10 05:29 | - |
| perl-Text-Autoformat/ | 2009-12-10 05:29 | - |
| perl-Text-CHM/ | 2009-12-10 05:29 | - |
| perl-Text-CSV_XS/ | 2009-12-10 05:29 | - |
| perl-Text-CharWidth/ | 2009-12-10 05:29 | - |
| perl-Text-Diff-HTML/ | 2009-12-10 05:29 | - |
| perl-Text-Diff/ | 2009-12-10 05:29 | - |
| perl-Text-Format/ | 2009-12-10 05:29 | - |
| perl-Text-Glob/ | 2009-12-10 05:29 | - |
| perl-Text-Iconv/ | 2009-12-10 05:29 | - |
| perl-Text-Levenshtein/ | 2009-12-10 05:29 | - |
| perl-Text-LevenshteinXS/ | 2009-12-10 05:29 | - |
| perl-Text-Reform/ | 2009-12-10 05:29 | - |
| perl-Text-SpellChecker/ | 2009-12-10 05:29 | - |
| perl-Text-Template/ | 2009-12-10 05:29 | - |
| perl-Text-Unidecode/ | 2009-12-10 05:29 | - |
| perl-Text-WordDiff/ | 2009-12-10 05:29 | - |
| perl-Text-WrapI18N/ | 2009-12-10 05:29 | - |
| perl-Text-vFile-asData/ | 2009-12-10 05:29 | - |
| perl-Tie-DBI/ | 2009-12-10 05:29 | - |
| perl-Tie-EncryptedHash/ | 2009-12-10 05:29 | - |
| perl-Tie-IxHash/ | 2009-12-10 05:29 | - |
| perl-Time-Duration/ | 2009-12-10 05:29 | - |
| perl-Time-Piece-MySQL/ | 2009-12-10 05:29 | - |
| perl-Time-Piece/ | 2009-12-10 05:29 | - |
| perl-TimeDate/ | 2009-12-10 05:29 | - |
| perl-Tk-TableMatrix/ | 2009-12-10 05:30 | - |
| perl-Tk/ | 2009-12-10 05:30 | - |
| perl-UNIVERSAL-can/ | 2009-12-10 05:30 | - |
| perl-UNIVERSAL-exports/ | 2009-12-10 05:30 | - |
| perl-UNIVERSAL-isa/ | 2009-12-10 05:30 | - |
| perl-UNIVERSAL-moniker/ | 2009-12-10 05:30 | - |
| perl-UNIVERSAL-require/ | 2009-12-10 05:30 | - |
| perl-Unicode-Map/ | 2009-12-10 05:30 | - |
| perl-Unicode-Map8/ | 2009-12-10 05:30 | - |
| perl-Unicode-MapUTF8/ | 2009-12-10 05:30 | - |
| perl-Unicode-String/ | 2009-12-10 05:30 | - |
| perl-Unix-Statgrab/ | 2009-12-10 05:30 | - |
| perl-Unix-Syslog/ | 2009-12-10 05:30 | - |
| perl-User-Identity/ | 2009-12-10 05:30 | - |
| perl-User/ | 2009-12-10 05:30 | - |
| perl-WWW-Search/ | 2009-12-10 05:30 | - |
| perl-Wx/ | 2009-12-10 05:30 | - |
| perl-XML-Atom-SimpleFeed/ | 2009-12-10 05:30 | - |
| perl-XML-DOM/ | 2009-12-10 05:30 | - |
| perl-XML-Entities/ | 2009-12-10 05:30 | - |
| perl-XML-Filter-BufferText/ | 2009-12-10 05:30 | - |
| perl-XML-Generator-DBI/ | 2009-12-10 05:30 | - |
| perl-XML-Handler-YAWriter/ | 2009-12-10 05:30 | - |
| perl-XML-Merge/ | 2009-12-10 05:30 | - |
| perl-XML-RSS/ | 2009-12-10 05:30 | - |
| perl-XML-RegExp/ | 2009-12-10 05:30 | - |
| perl-XML-SAX-Writer/ | 2009-12-10 05:30 | - |
| perl-XML-Simple-DTDReader/ | 2009-12-10 05:30 | - |
| perl-XML-Simple/ | 2009-12-10 05:30 | - |
| perl-XML-Smart/ | 2009-12-10 05:30 | - |
| perl-XML-Tidy/ | 2009-12-10 05:30 | - |
| perl-XML-TreeBuilder/ | 2009-12-10 05:30 | - |
| perl-XML-Writer/ | 2009-12-10 05:30 | - |
| perl-XML-XPath/ | 2009-12-10 05:30 | - |
| perl-XML-XQL/ | 2009-12-10 05:30 | - |
| perl-XML-Xerces/ | 2009-12-10 05:30 | - |
| perl-YAML-Parser-Syck/ | 2009-12-10 05:30 | - |
| perl-YAML-Syck/ | 2009-12-10 05:30 | - |
| perl-YAML-Tiny/ | 2009-12-10 05:30 | - |
| perl-YAML/ | 2009-12-10 05:30 | - |
| perl-ccom/ | 2009-12-10 05:30 | - |
| perl-eperl/ | 2009-12-10 05:30 | - |
| perl-libintl/ | 2009-12-10 05:30 | - |
| perl-libwhisker2/ | 2009-12-10 05:30 | - |
| perl-mogilefs-server/ | 2009-12-10 05:30 | - |
| perl-pmtools/ | 2009-12-10 05:30 | - |
| perl-version/ | 2009-12-10 05:30 | - |
| pexpect/ | 2009-12-10 05:30 | - |
| pfqueue/ | 2009-12-10 05:30 | - |
| pg_top/ | 2009-12-10 05:30 | - |
| pgadmin3/ | 2009-12-10 05:30 | - |
| pgfouine/ | 2009-12-10 05:30 | - |
| pgp-tools/ | 2009-12-10 05:30 | - |
| phoronix-test-suite/ | 2009-12-10 05:30 | - |
| php-adodb/ | 2009-12-10 05:30 | - |
| php-eaccelerator/ | 2009-12-10 05:30 | - |
| php-extras/ | 2009-12-10 05:30 | - |
| php-idn/ | 2009-12-10 05:30 | - |
| php-magickwand/ | 2009-12-10 05:30 | - |
| php-magpierss/ | 2009-12-10 05:30 | - |
| php-mmcache/ | 2009-12-10 05:30 | - |
| php-pear-HTTP-Client/ | 2009-12-10 05:30 | - |
| php-pear-Mail-Mime/ | 2009-12-10 05:30 | - |
| php-pear-Phlickr/ | 2009-12-10 05:30 | - |
| php-pecl-apc/ | 2009-12-10 05:30 | - |
| php-pecl-json/ | 2009-12-10 05:30 | - |
| php-pecl-mailparse/ | 2009-12-10 05:30 | - |
| php-pecl-memcache/ | 2009-12-10 05:30 | - |
| php-pecl-zip/ | 2009-12-10 05:30 | - |
| php-spyc/ | 2009-12-10 05:30 | - |
| phpMyAdmin/ | 2009-12-10 05:30 | - |
| phpPgAdmin/ | 2009-12-10 05:30 | - |
| phpldapadmin/ | 2009-12-10 05:30 | - |
| physfs/ | 2009-12-10 05:30 | - |
| pinentry/ | 2009-12-10 05:30 | - |
| pisg/ | 2009-12-10 05:30 | - |
| plague/ | 2009-12-10 05:30 | - |
| plone/ | 2009-12-10 05:30 | - |
| plotutils/ | 2009-12-10 05:30 | - |
| plplot/ | 2009-12-10 05:30 | - |
| pnp4nagios/ | 2009-12-10 05:30 | - |
| po4a/ | 2009-12-10 05:30 | - |
| portaudio/ | 2009-12-10 05:30 | - |
| postgis/ | 2009-12-10 05:30 | - |
| postgresql-dbi-link/ | 2009-12-10 05:30 | - |
| postgresql-ip4r/ | 2009-12-10 05:30 | - |
| postgresql-pgpool-II/ | 2009-12-10 05:30 | - |
| postgresql-pgpool-ha/ | 2009-12-10 05:30 | - |
| postgresql-pgpool/ | 2009-12-10 05:30 | - |
| postgresql-pgpoolAdmin/ | 2009-12-10 05:30 | - |
| postgresql-plruby/ | 2009-12-10 05:30 | - |
| postgresql-table_log/ | 2009-12-10 05:30 | - |
| postgresql_autodoc/ | 2009-12-10 05:30 | - |
| postgrey/ | 2009-12-10 05:30 | - |
| poweradmin/ | 2009-12-10 05:30 | - |
| powerman/ | 2009-12-10 05:30 | - |
| powermanga/ | 2009-12-10 05:30 | - |
| pptp/ | 2009-12-10 05:30 | - |
| proftpd/ | 2009-12-10 05:30 | - |
| proj/ | 2009-12-10 05:30 | - |
| pstoedit/ | 2009-12-10 05:30 | - |
| pth/ | 2009-12-10 05:30 | - |
| ptrash/ | 2009-12-10 05:30 | - |
| publican-fedora/ | 2009-12-10 05:30 | - |
| publican/ | 2009-12-10 05:30 | - |
| puppet/ | 2009-12-10 05:30 | - |
| pv/ | 2009-12-10 05:30 | - |
| pwgen/ | 2009-12-10 05:30 | - |
| pwsafe/ | 2009-12-10 05:30 | - |
| pxe-kexec/ | 2009-12-10 05:30 | - |
| py-radix/ | 2009-12-10 05:30 | - |
| pyPdf/ | 2009-12-10 05:30 | - |
| pychart/ | 2009-12-10 05:30 | - |
| pydot/ | 2009-12-10 05:30 | - |
| pyflakes/ | 2009-12-10 05:30 | - |
| pygpgme/ | 2009-12-10 05:30 | - |
| pygrace/ | 2009-12-10 05:30 | - |
| pyhton-utmp/ | 2009-12-10 05:30 | - |
| pyicq-t/ | 2009-12-10 05:30 | - |
| pykdeextensions/ | 2009-12-10 05:30 | - |
| pyke/ | 2009-12-10 05:30 | - |
| pylibacl/ | 2009-12-10 05:30 | - |
| pyparsing/ | 2009-12-10 05:30 | - |
| python-Coherence/ | 2009-12-10 05:30 | - |
| python-GeoIP/ | 2009-12-10 05:30 | - |
| python-GnuPGInterface/ | 2009-12-10 05:30 | - |
| python-IPy/ | 2009-12-10 05:30 | - |
| python-Levenshtein/ | 2009-12-10 05:30 | - |
| python-ZSI/ | 2009-12-10 05:30 | - |
| python-application/ | 2009-12-10 05:30 | - |
| python-basemap-data/ | 2009-12-10 05:30 | - |
| python-basemap/ | 2009-12-10 05:30 | - |
| python-boto/ | 2009-12-10 05:30 | - |
| python-cheetah/ | 2009-12-10 05:30 | - |
| python-cherrypy/ | 2009-12-10 05:30 | - |
| python-chm/ | 2009-12-10 05:30 | - |
| python-configobj/ | 2009-12-10 05:30 | - |
| python-coverage/ | 2009-12-10 05:30 | - |
| python-crypto/ | 2009-12-10 05:30 | - |
| python-dateutil/ | 2009-12-10 05:30 | - |
| python-decoratortools/ | 2009-12-10 05:30 | - |
| python-dictclient/ | 2009-12-10 05:30 | - |
| python-dmidecode/ | 2009-12-17 20:46 | - |
| python-dns/ | 2009-12-10 05:30 | - |
| python-docutils/ | 2009-12-10 05:30 | - |
| python-dtopt/ | 2009-12-10 05:30 | - |
| python-elementtree/ | 2009-12-10 05:30 | - |
| python-feedparser/ | 2009-12-10 05:30 | - |
| python-formencode/ | 2009-12-10 05:30 | - |
| python-gammu/ | 2009-12-10 05:30 | - |
| python-genshi/ | 2009-12-10 05:30 | - |
| python-gnutls/ | 2009-12-10 05:30 | - |
| python-guppy/ | 2009-12-10 05:30 | - |
| python-html2text/ | 2009-12-10 05:30 | - |
| python-id3/ | 2009-12-10 05:30 | - |
| python-imaging/ | 2009-12-10 05:30 | - |
| python-isprelink/ | 2009-12-10 05:30 | - |
| python-json/ | 2009-12-10 05:30 | - |
| python-kid/ | 2009-12-10 05:30 | - |
| python-kinterbasdb/ | 2009-12-10 05:30 | - |
| python-krbV/ | 2009-12-10 05:30 | - |
| python-ldaphelper/ | 2009-12-10 05:30 | - |
| python-libgmail-docs/ | 2009-12-10 05:30 | - |
| python-libgmail/ | 2009-12-10 05:30 | - |
| python-lirc/ | 2009-12-10 05:30 | - |
| python-louie/ | 2009-12-10 05:30 | - |
| python-lxml/ | 2009-12-10 05:30 | - |
| python-matplotlib/ | 2009-12-10 05:30 | - |
| python-metar/ | 2009-12-10 05:30 | - |
| python-morbid/ | 2009-12-10 05:30 | - |
| python-mwclient/ | 2009-12-10 05:30 | - |
| python-netaddr/ | 2009-12-10 05:30 | - |
| python-nevow/ | 2009-12-10 05:30 | - |
| python-nltk/ | 2009-12-10 05:30 | - |
| python-nose/ | 2009-12-10 05:30 | - |
| python-numarray/ | 2009-12-10 05:30 | - |
| python-ogg/ | 2009-12-10 05:30 | - |
| python-openid/ | 2009-12-10 05:30 | - |
| python-paste-deploy/ | 2009-12-10 05:30 | - |
| python-paste-script/ | 2009-12-10 05:30 | - |
| python-paste/ | 2009-12-10 05:30 | - |
| python-peak-rules/ | 2009-12-10 05:30 | - |
| python-peak-util-addons/ | 2009-12-10 05:30 | - |
| python-peak-util-assembler/ | 2009-12-10 05:30 | - |
| python-peak-util-extremes/ | 2009-12-10 05:30 | - |
| python-peak-util-symbols/ | 2009-12-10 05:30 | - |
| python-pgsql/ | 2009-12-10 05:30 | - |
| python-pip/ | 2009-12-10 05:30 | - |
| python-ply/ | 2009-12-10 05:30 | - |
| python-pp/ | 2009-12-10 05:30 | - |
| python-prioritized-methods/ | 2009-12-10 05:30 | - |
| python-protocols/ | 2009-12-10 05:30 | - |
| python-psycopg2/ | 2009-12-10 05:30 | - |
| python-pycurl/ | 2009-12-10 05:30 | - |
| python-pygments/ | 2009-12-10 05:30 | - |
| python-pygooglechart/ | 2009-12-10 05:30 | - |
| python-pyrad/ | 2009-12-10 05:30 | - |
| python-pysctp/ | 2009-12-10 05:30 | - |
| python-ruledispatch/ | 2009-12-10 05:30 | - |
| python-setuptools/ | 2009-12-10 05:30 | - |
| python-shove/ | 2009-12-10 05:30 | - |
| python-simplejson/ | 2009-12-10 05:30 | - |
| python-sippy/ | 2009-12-10 05:30 | - |
| python-sqlalchemy/ | 2009-12-10 05:30 | - |
| python-sqlite/ | 2009-12-10 05:30 | - |
| python-sqlite2/ | 2009-12-10 05:30 | - |
| python-sqlobject/ | 2009-12-10 05:30 | - |
| python-ssl/ | 2009-12-10 05:30 | - |
| python-suds/ | 2009-12-10 05:30 | - |
| python-tag/ | 2009-12-10 05:30 | - |
| python-text_table/ | 2009-12-10 05:30 | - |
| python-tgfastdata/ | 2009-12-10 05:30 | - |
| python-turbocheetah/ | 2009-12-10 05:30 | - |
| python-turbojson/ | 2009-12-10 05:30 | - |
| python-turbokid/ | 2009-12-10 05:30 | - |
| python-twitter/ | 2009-12-10 05:30 | - |
| python-urlgrabber/ | 2009-12-10 05:30 | - |
| python-urljr/ | 2009-12-10 05:30 | - |
| python-utmp/ | 2009-12-10 05:30 | - |
| python-uuid/ | 2009-12-10 05:30 | - |
| python-vorbis/ | 2009-12-10 05:30 | - |
| python-webob/ | 2009-12-10 05:30 | - |
| python-webpy/ | 2009-12-10 05:30 | - |
| python-webtest/ | 2009-12-10 05:30 | - |
| python-werkzeug/ | 2009-12-10 05:30 | - |
| python-xlrd/ | 2009-12-10 05:30 | - |
| python-xmpp/ | 2009-12-10 05:30 | - |
| python-yadis/ | 2009-12-10 05:30 | - |
| python-zope-interface/ | 2009-12-10 05:30 | - |
| pytz/ | 2009-12-10 05:30 | - |
| pyxattr/ | 2009-12-10 05:30 | - |
| pyxdg/ | 2009-12-10 05:30 | - |
| pyzor/ | 2009-12-10 05:30 | - |
| qemu/ | 2009-12-10 05:30 | - |
| qfaxreader/ | 2009-12-10 05:30 | - |
| qgit/ | 2009-12-10 05:30 | - |
| qiv/ | 2009-12-10 05:30 | - |
| qosmic/ | 2009-12-10 05:30 | - |
| qstat/ | 2009-12-10 05:30 | - |
| qt4-qsa/ | 2009-12-10 05:30 | - |
| qt4/ | 2009-12-10 05:30 | - |
| qtparted/ | 2009-12-10 05:30 | - |
| qucs/ | 2009-12-10 05:30 | - |
| queuegraph/ | 2009-12-10 05:30 | - |
| quilt/ | 2009-12-10 05:30 | - |
| rancid/ | 2009-12-10 05:30 | - |
| rbldnsd/ | 2009-12-10 05:30 | - |
| rdiff-backup/ | 2009-12-10 05:30 | - |
| re2c/ | 2009-12-10 05:30 | - |
| recode/ | 2009-12-10 05:30 | - |
| redet-doc/ | 2009-12-10 05:30 | - |
| redet/ | 2009-12-10 05:30 | - |
| redir/ | 2009-12-10 05:30 | - |
| rekall/ | 2009-12-10 05:30 | - |
| remctl/ | 2009-12-10 05:30 | - |
| remind/ | 2009-12-10 05:30 | - |
| revelation/ | 2009-12-10 05:30 | - |
| rhino/ | 2009-12-10 05:30 | - |
| rhnlib/ | 2009-12-10 05:30 | - |
| rhnpush/ | 2009-12-10 05:30 | - |
| ris-linux/ | 2009-12-10 05:30 | - |
| rkhunter/ | 2009-12-10 05:30 | - |
| rlog/ | 2009-12-10 05:30 | - |
| rlwrap/ | 2009-12-10 05:30 | - |
| rmol/ | 2009-12-10 05:30 | - |
| roadstencil-fonts/ | 2009-12-10 05:30 | - |
| rocksndiamonds/ | 2009-12-10 05:30 | - |
| rootsh/ | 2009-12-10 05:30 | - |
| roundcubemail/ | 2009-12-10 05:30 | - |
| roundup/ | 2009-12-10 05:30 | - |
| rpl/ | 2009-12-10 05:30 | - |
| rpmconf/ | 2009-12-10 05:30 | - |
| rpmdevtools/ | 2009-12-10 05:30 | - |
| rpmlint/ | 2009-12-10 05:30 | - |
| rpmreaper/ | 2009-12-10 05:30 | - |
| rrdtool/ | 2009-12-10 05:30 | - |
| rss2email/ | 2009-12-10 05:30 | - |
| rsstool/ | 2009-12-10 05:30 | - |
| rtpproxy/ | 2009-12-10 05:30 | - |
| ruby-augeas/ | 2009-12-10 05:30 | - |
| ruby-ldap/ | 2009-12-10 05:30 | - |
| ruby-mysql/ | 2009-12-10 05:30 | - |
| rubygem-daemons/ | 2009-12-10 05:30 | - |
| rubygem-facets/ | 2009-12-10 05:30 | - |
| rubygem-fastthread/ | 2009-12-10 05:30 | - |
| rubygem-fattr/ | 2009-12-10 05:30 | - |
| rubygem-ferret/ | 2009-12-10 05:30 | - |
| rubygem-gem_plugin/ | 2009-12-10 05:30 | - |
| rubygem-hawler/ | 2009-12-10 05:30 | - |
| rubygem-main/ | 2009-12-10 05:30 | - |
| rubygem-markaby/ | 2009-12-10 05:30 | - |
| rubygem-mocha/ | 2009-12-10 05:30 | - |
| rubygem-mongrel/ | 2009-12-10 05:30 | - |
| rubygem-pervasives/ | 2009-12-10 05:30 | - |
| rubygem-picnic/ | 2009-12-10 05:30 | - |
| rubygem-rack/ | 2009-12-10 05:30 | - |
| rubygem-restr/ | 2009-12-10 05:30 | - |
| rubygem-reststop/ | 2009-12-10 05:30 | - |
| rubygem-sqlite3-ruby/ | 2009-12-10 05:30 | - |
| rubygems/ | 2009-12-10 05:30 | - |
| rxvt-unicode/ | 2009-12-10 05:30 | - |
| rxvt/ | 2009-12-10 05:30 | - |
| rzip/ | 2009-12-10 05:30 | - |
| sagator/ | 2009-12-10 05:30 | - |
| sbcl/ | 2009-12-10 05:30 | - |
| sblim-cim-client/ | 2009-12-10 05:30 | - |
| sblim-cim-client2/ | 2009-12-10 05:30 | - |
| sblim-cmpi-base/ | 2009-12-10 05:30 | - |
| sblim-cmpi-devel/ | 2009-12-10 05:30 | - |
| sblim-cmpi-dhcp/ | 2009-12-10 05:30 | - |
| sblim-cmpi-dns/ | 2009-12-10 05:30 | - |
| sblim-cmpi-fsvol/ | 2009-12-10 05:30 | - |
| sblim-cmpi-network/ | 2009-12-10 05:30 | - |
| sblim-cmpi-nfsv3/ | 2009-12-10 05:30 | - |
| sblim-cmpi-nfsv4/ | 2009-12-10 05:30 | - |
| sblim-cmpi-params/ | 2009-12-10 05:30 | - |
| sblim-cmpi-rpm/ | 2009-12-10 05:30 | - |
| sblim-cmpi-samba/ | 2009-12-10 05:30 | - |
| sblim-cmpi-sysfs/ | 2009-12-10 05:30 | - |
| sblim-cmpi-syslog/ | 2009-12-10 05:30 | - |
| sblim-gather/ | 2009-12-10 05:30 | - |
| sblim-indication_helper/ | 2009-12-10 05:30 | - |
| sblim-sfcb/ | 2009-12-10 05:30 | - |
| sblim-sfcc/ | 2009-12-10 05:30 | - |
| sblim-testsuite/ | 2009-12-10 05:30 | - |
| sblim-tools-libra/ | 2009-12-10 05:30 | - |
| sblim-wbemcli/ | 2009-12-10 05:30 | - |
| scalapack/ | 2009-12-10 05:30 | - |
| scim-anthy/ | 2009-12-10 05:30 | - |
| scim-bridge/ | 2009-12-10 05:30 | - |
| scim-chewing/ | 2009-12-10 05:30 | - |
| scim-hangul/ | 2009-12-10 05:30 | - |
| scim-m17n/ | 2009-12-10 05:30 | - |
| scim-pinyin/ | 2009-12-10 05:30 | - |
| scim-qtimm/ | 2009-12-10 05:30 | - |
| scim-tables/ | 2009-12-10 05:30 | - |
| scim/ | 2009-12-10 05:30 | - |
| scipy/ | 2009-12-10 05:30 | - |
| scitools/ | 2009-12-10 05:30 | - |
| scons/ | 2009-12-10 05:30 | - |
| scponly/ | 2009-12-10 05:30 | - |
| scrub/ | 2009-12-10 05:30 | - |
| sdparm/ | 2009-12-10 05:30 | - |
| sems/ | 2009-12-10 05:30 | - |
| ser2net/ | 2009-12-10 05:30 | - |
| shapelib/ | 2009-12-10 05:30 | - |
| shed/ | 2009-12-10 05:30 | - |
| shorewall/ | 2009-12-10 05:30 | - |
| silkscreen-fonts/ | 2009-12-10 05:30 | - |
| sing/ | 2009-12-10 05:30 | - |
| sip-redirect/ | 2009-12-10 05:30 | - |
| sipcalc/ | 2009-12-10 05:30 | - |
| sipp/ | 2009-12-10 05:30 | - |
| sipsak/ | 2009-12-10 05:30 | - |
| sks/ | 2009-12-10 05:30 | - |
| sl/ | 2009-12-10 05:30 | - |
| sleuthkit/ | 2009-12-10 05:30 | - |
| smart/ | 2009-12-10 05:30 | - |
| smbldap-tools/ | 2009-12-10 05:30 | - |
| smolt/ | 2009-12-10 05:30 | - |
| smp_utils/ | 2009-12-10 05:30 | - |
| smstools/ | 2009-12-10 05:30 | - |
| snake/ | 2009-12-10 05:30 | - |
| snort/ | 2009-12-10 05:30 | - |
| sobby/ | 2009-12-10 05:30 | - |
| sos/ | 2009-12-10 05:30 | - |
| spacewalk-proxy-docs/ | 2009-12-10 05:30 | - |
| spamass-milter/ | 2009-12-10 05:30 | - |
| spampd/ | 2009-12-10 05:30 | - |
| sparse/ | 2009-12-10 05:30 | - |
| spawn-fcgi/ | 2009-12-10 05:30 | - |
| specto/ | 2009-12-10 05:30 | - |
| sportrop-fonts/ | 2009-12-10 05:30 | - |
| spr/ | 2009-12-10 05:30 | - |
| sqlgrey/ | 2009-12-10 05:30 | - |
| sqlite/ | 2009-12-10 05:30 | - |
| ssmtp/ | 2009-12-10 05:30 | - |
| starfighter/ | 2009-12-10 05:30 | - |
| stomppy/ | 2009-12-10 05:30 | - |
| stripesnoop/ | 2009-12-10 05:30 | - |
| sub2srt/ | 2009-12-10 05:30 | - |
| suitesparse/ | 2009-12-10 05:30 | - |
| superiotool/ | 2009-12-10 05:30 | - |
| supertux/ | 2009-12-10 05:30 | - |
| supybot/ | 2009-12-10 05:30 | - |
| svgalib/ | 2009-12-10 05:30 | - |
| svnmailer/ | 2009-12-10 05:30 | - |
| synaptic/ | 2009-12-10 05:30 | - |
| synergy-plus/ | 2009-12-10 05:30 | - |
| synergy/ | 2009-12-10 05:30 | - |
| sysbench/ | 2009-12-10 05:30 | - |
| syslog-ng/ | 2009-12-10 05:30 | - |
| sysusage/ | 2009-12-10 05:30 | - |
| t1lib/ | 2009-12-10 05:30 | - |
| tachyon/ | 2009-12-10 05:30 | - |
| taglib/ | 2009-12-10 05:30 | - |
| tbcload/ | 2009-12-10 05:30 | - |
| tcl-mysqltcl/ | 2009-12-10 05:30 | - |
| tcl-tcludp/ | 2009-12-10 05:30 | - |
| tcl-tclvfs/ | 2009-12-10 05:30 | - |
| tcl-tktreectrl/ | 2009-12-10 05:30 | - |
| tclchecker/ | 2009-12-10 05:30 | - |
| tclcompiler/ | 2009-12-10 05:30 | - |
| tcldebugger/ | 2009-12-10 05:30 | - |
| tcldom/ | 2009-12-10 05:30 | - |
| tcllib/ | 2009-12-10 05:30 | - |
| tclparser/ | 2009-12-10 05:30 | - |
| tclpro/ | 2009-12-10 05:30 | - |
| tclxml/ | 2009-12-10 05:30 | - |
| tcpick/ | 2009-12-10 05:30 | - |
| tcptraceroute/ | 2009-12-10 05:30 | - |
| tcputils/ | 2009-12-10 05:30 | - |
| tcpxtract/ | 2009-12-10 05:30 | - |
| tdma/ | 2009-12-10 05:30 | - |
| tdom/ | 2009-12-10 05:30 | - |
| testdisk/ | 2009-12-10 05:30 | - |
| tetex-elsevier/ | 2009-12-10 05:30 | - |
| tetex-lineno/ | 2009-12-10 05:30 | - |
| tetex-tex4ht/ | 2009-12-10 05:30 | - |
| tex-simplecv/ | 2009-12-10 05:30 | - |
| tidy/ | 2009-12-10 05:30 | - |
| timidity++/ | 2009-12-10 05:30 | - |
| tinyproxy/ | 2009-12-10 05:30 | - |
| tiobench/ | 2009-12-10 05:30 | - |
| tiquit/ | 2009-12-10 05:30 | - |
| tiresias-fonts/ | 2009-12-10 05:30 | - |
| tklib/ | 2009-12-10 05:30 | - |
| tlock/ | 2009-12-10 05:30 | - |
| tmda/ | 2009-12-10 05:30 | - |
| torcs-data/ | 2009-12-10 05:30 | - |
| torcs/ | 2009-12-10 05:30 | - |
| torque/ | 2009-12-17 20:47 | - |
| touchcal/ | 2009-12-10 05:30 | - |
| trac-git-plugin/ | 2009-12-10 05:30 | - |
| trac-iniadmin-plugin/ | 2009-12-10 05:30 | - |
| trac-mercurial-plugin/ | 2009-12-10 05:30 | - |
| trac-webadmin/ | 2009-12-10 05:30 | - |
| trac/ | 2009-12-10 05:30 | - |
| transmission/ | 2009-12-10 05:30 | - |
| trickle/ | 2009-12-10 05:30 | - |
| ttf2pt1/ | 2009-12-10 05:30 | - |
| ttywatch/ | 2009-12-10 05:30 | - |
| tuxpaint-stamps/ | 2009-12-10 05:30 | - |
| tuxpaint/ | 2009-12-10 05:30 | - |
| tuxtype2/ | 2009-12-10 05:30 | - |
| txt2man/ | 2009-12-10 05:30 | - |
| txt2tags/ | 2009-12-10 05:30 | - |
| tzdata-java/ | 2009-12-10 05:30 | - |
| uberftp/ | 2009-12-10 05:30 | - |
| ucarp/ | 2009-12-10 05:30 | - |
| ucl/ | 2009-12-10 05:30 | - |
| ucview/ | 2009-12-10 05:30 | - |
| udunits/ | 2009-12-10 05:30 | - |
| unicap/ | 2009-12-10 05:30 | - |
| unicornscan/ | 2009-12-10 05:30 | - |
| unison213/ | 2009-12-10 05:30 | - |
| unison227/ | 2009-12-10 05:30 | - |
| unpaper/ | 2009-12-10 05:30 | - |
| unshield/ | 2009-12-10 05:30 | - |
| up-imapproxy/ | 2009-12-10 05:30 | - |
| upx/ | 2009-12-10 05:30 | - |
| uread/ | 2009-12-10 05:30 | - |
| ushare/ | 2009-12-10 05:30 | - |
| ustr/ | 2009-12-10 05:30 | - |
| uuid/ | 2009-12-10 05:30 | - |
| uw-imap/ | 2009-12-10 05:30 | - |
| varnish/ | 2009-12-10 05:30 | - |
| vblade/ | 2009-12-10 05:30 | - |
| viewvc/ | 2009-12-10 05:30 | - |
| virtaal/ | 2009-12-10 05:30 | - |
| viruskiller/ | 2009-12-10 05:30 | - |
| vnc-ltsp-config/ | 2009-12-10 05:30 | - |
| vnstat/ | 2009-12-10 05:30 | - |
| voms-mysql-plugin/ | 2009-12-10 05:30 | - |
| voms/ | 2009-12-10 05:30 | - |
| vpnc/ | 2009-12-10 05:30 | - |
| vttest/ | 2009-12-10 05:30 | - |
| vtun/ | 2009-12-10 05:30 | - |
| vym/ | 2009-12-10 05:30 | - |
| wammu/ | 2009-12-10 05:30 | - |
| wavpack/ | 2009-12-10 05:30 | - |
| wdm/ | 2009-12-10 05:30 | - |
| websec/ | 2009-12-10 05:30 | - |
| websvn/ | 2009-12-10 05:30 | - |
| weechat/ | 2009-12-10 05:30 | - |
| wesnoth/ | 2009-12-10 05:30 | - |
| wgrib/ | 2009-12-10 05:30 | - |
| wgrib2/ | 2009-12-10 05:30 | - |
| whatmask/ | 2009-12-10 05:30 | - |
| whatsup/ | 2009-12-10 05:30 | - |
| windowlab/ | 2009-12-10 05:30 | - |
| wine-docs/ | 2009-12-10 05:30 | - |
| wine/ | 2009-12-10 05:30 | - |
| winpdb/ | 2009-12-10 05:30 | - |
| wipe/ | 2009-12-10 05:30 | - |
| wlassistant/ | 2009-12-10 05:30 | - |
| wmacpi/ | 2009-12-10 05:30 | - |
| wmix/ | 2009-12-10 05:30 | - |
| wordpress-plugin-bad-behavior/ | 2009-12-10 05:30 | - |
| wput/ | 2009-12-10 05:30 | - |
| wsmancli/ | 2009-12-10 05:30 | - |
| wv2/ | 2009-12-10 05:30 | - |
| wxGTK/ | 2009-12-10 05:30 | - |
| xalan-c/ | 2009-12-10 05:30 | - |
| xar/ | 2009-12-10 05:30 | - |
| xarchiver/ | 2009-12-10 05:30 | - |
| xautolock/ | 2009-12-10 05:30 | - |
| xbae/ | 2009-12-10 05:30 | - |
| xbase/ | 2009-12-10 05:30 | - |
| xbiso/ | 2009-12-10 05:30 | - |
| xbsql/ | 2009-12-10 05:30 | - |
| xclip/ | 2009-12-10 05:30 | - |
| xdg-utils/ | 2009-12-10 05:30 | - |
| xdialog/ | 2009-12-10 05:30 | - |
| xerces-c/ | 2009-12-10 05:30 | - |
| xforms/ | 2009-12-10 05:30 | - |
| xkeycaps/ | 2009-12-10 05:30 | - |
| xml-security-c/ | 2009-12-10 05:30 | - |
| xmltooling/ | 2009-12-10 05:30 | - |
| xmms-acme/ | 2009-12-10 05:30 | - |
| xmms-arts/ | 2009-12-10 05:30 | - |
| xmms-crossfade/ | 2009-12-10 05:30 | - |
| xmms-flac/ | 2009-12-10 05:30 | - |
| xmms-lirc/ | 2009-12-10 05:30 | - |
| xmms-musepack/ | 2009-12-10 05:30 | - |
| xmms-skins/ | 2009-12-10 05:30 | - |
| xmms-speex/ | 2009-12-10 05:30 | - |
| xorriso/ | 2009-12-10 05:30 | - |
| xrdp/ | 2009-12-10 05:30 | - |
| xsupplicant/ | 2009-12-10 05:30 | - |
| xvattr/ | 2009-12-10 05:30 | - |
| yapet/ | 2009-12-10 05:30 | - |
| yasm/ | 2009-12-10 05:30 | - |
| yaz/ | 2009-12-10 05:30 | - |
| ytalk/ | 2009-12-10 05:30 | - |
| yum-arch/ | 2009-12-10 05:30 | - |
| yum/ | 2009-12-10 05:30 | - |
| zabbix/ | 2009-12-10 05:30 | - |
| znc-extra/ | 2009-12-10 05:30 | - |
| znc/ | 2009-12-10 05:30 | - |
| zope/ | 2009-12-10 05:30 | - |
| zziplib/ | 2009-12-10 05:30 | - |